The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N4-(2-(2,4-dichlorobenzyloxy)-6-methoxyquinolin-8-yl)pentane-1,4-diamine maleate ID: ALA3274183
PubChem CID: 90678562
Max Phase: Preclinical
Molecular Formula: C26H29Cl2N3O6
Molecular Weight: 434.37
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: COc1cc(NC(C)CCCN)c2nc(OCc3ccc(Cl)cc3Cl)ccc2c1.O=C(O)/C=C\C(=O)O
Standard InChI: InChI=1S/C22H25Cl2N3O2.C4H4O4/c1-14(4-3-9-25)26-20-12-18(28-2)10-15-6-8-21(27-22(15)20)29-13-16-5-7-17(23)11-19(16)24;5-3(6)1-2-4(7)8/h5-8,10-12,14,26H,3-4,9,13,25H2,1-2H3;1-2H,(H,5,6)(H,7,8)/b;2-1-
Standard InChI Key: MSNOQLAEBDHGTF-BTJKTKAUSA-N
Molfile:
RDKit 2D
37 38 0 0 0 0 0 0 0 0999 V2000
11.0196 -1.6795 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.6071 -2.3939 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.7821 -2.3939 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.3696 -1.6795 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.6071 -0.9650 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.8446 -1.6795 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.5446 -1.6795 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.7821 -0.9650 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.2985 -3.0291 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2974 -3.8565 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0121 -4.2694 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0103 -2.6163 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7257 -3.0255 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7265 -3.8523 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4417 -4.2632 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.1568 -3.8485 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1521 -3.0185 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4362 -2.6113 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5839 -2.6167 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.5837 -1.7917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.8729 -4.2582 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.5857 -3.8429 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3018 -4.2527 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3003 -5.0760 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.0155 -5.4856 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.7294 -5.0703 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.7235 -4.2411 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.0076 -3.8351 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0140 -5.0943 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.3005 -5.5085 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3024 -6.3335 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5851 -5.0976 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8716 -5.5118 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1562 -5.1009 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4427 -5.5150 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
12.4459 -5.4791 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
11.0002 -3.0103 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 2 0
3 4 1 0
1 5 2 0
1 6 1 0
4 7 2 0
4 8 1 0
9 10 2 0
10 11 1 0
11 14 2 0
13 12 2 0
12 9 1 0
13 14 1 0
14 15 1 0
15 16 2 0
16 17 1 0
17 18 2 0
18 13 1 0
9 19 1 0
19 20 1 0
16 21 1 0
21 22 1 0
22 23 1 0
23 24 2 0
24 25 1 0
25 26 2 0
26 27 1 0
27 28 2 0
28 23 1 0
11 29 1 0
29 30 1 0
30 31 1 0
30 32 1 0
32 33 1 0
33 34 1 0
34 35 1 0
26 36 1 0
28 37 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 434.37Molecular Weight (Monoisotopic): 433.1324AlogP: 5.67#Rotatable Bonds: 9Polar Surface Area: 69.40Molecular Species: BASEHBA: 5HBD: 2#RO5 Violations: 1HBA (Lipinski): 5HBD (Lipinski): 3#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 10.20CX LogP: 5.01CX LogD: 2.41Aromatic Rings: 3Heavy Atoms: 29QED Weighted: 0.45Np Likeness Score: -0.95
References 1. Shetty RV, Wetter WP, Blanton CD.. (1977) Synthesis of 2-benzyloxy and 2-benzylthio analogues of primaquine as potential antimalarials., 20 (10): [PMID:409843 ] [10.1021/jm00220a025 ]