N4-(2-(benzyloxy)-6-methoxyquinolin-8-yl)pentane-1,4-diamine maleate

ID: ALA3274187

PubChem CID: 90678566

Max Phase: Preclinical

Molecular Formula: C26H31N3O6

Molecular Weight: 365.48

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  COc1cc(NC(C)CCCN)c2nc(OCc3ccccc3)ccc2c1.O=C(O)/C=C\C(=O)O

Standard InChI:  InChI=1S/C22H27N3O2.C4H4O4/c1-16(7-6-12-23)24-20-14-19(26-2)13-18-10-11-21(25-22(18)20)27-15-17-8-4-3-5-9-17;5-3(6)1-2-4(7)8/h3-5,8-11,13-14,16,24H,6-7,12,15,23H2,1-2H3;1-2H,(H,5,6)(H,7,8)/b;2-1-

Standard InChI Key:  UPYRUJWCOZMAFT-BTJKTKAUSA-N

Molfile:  

     RDKit          2D

 35 36  0  0  0  0  0  0  0  0999 V2000
   11.3438   -3.4179    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.9313   -4.1324    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.1063   -4.1324    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.6938   -3.4179    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.9313   -2.7034    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   12.1688   -3.4179    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.8688   -3.4179    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.1063   -2.7034    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.4071   -5.8911    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.1215   -6.3036    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.1215   -7.1286    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4071   -7.5411    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.6926   -7.1286    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9781   -7.5411    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2636   -7.1286    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2636   -6.3036    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9781   -5.8911    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.6926   -6.3036    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9781   -5.0661    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.2636   -4.6536    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2636   -3.8286    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9781   -3.4161    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9781   -2.5911    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.6926   -2.1786    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.5492   -7.5411    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.5492   -8.3661    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.8360   -5.8911    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.5505   -6.3036    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.2649   -5.8911    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.2649   -5.0661    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.9794   -4.6536    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.6939   -5.0661    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.6939   -5.8911    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.9794   -6.3036    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5491   -5.0661    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  2  0
  3  4  1  0
  1  5  2  0
  1  6  1  0
  4  7  2  0
  4  8  1  0
  9 10  2  0
 10 11  1  0
 11 12  2  0
 12 13  1  0
 13 14  2  0
 14 15  1  0
 15 16  2  0
 16 17  1  0
 17 18  2  0
  9 18  1  0
 13 18  1  0
 20 21  1  0
 21 22  1  0
 22 23  1  0
 19 20  1  0
 23 24  1  0
 17 19  1  0
 25 26  1  0
 15 25  1  0
 28 29  1  0
 29 30  1  0
 30 31  2  0
 31 32  1  0
 32 33  2  0
 33 34  1  0
 29 34  2  0
 27 28  1  0
 10 27  1  0
 20 35  1  0
M  END

Associated Targets(non-human)

Plasmodium cynomolgi (553 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 365.48Molecular Weight (Monoisotopic): 365.2103AlogP: 4.36#Rotatable Bonds: 9
Polar Surface Area: 69.40Molecular Species: BASEHBA: 5HBD: 2
#RO5 Violations: HBA (Lipinski): 5HBD (Lipinski): 3#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 10.20CX LogP: 3.80CX LogD: 1.20
Aromatic Rings: 3Heavy Atoms: 27QED Weighted: 0.59Np Likeness Score: -0.59

References

1. Shetty RV, Wetter WP, Blanton CD..  (1977)  Synthesis of 2-benzyloxy and 2-benzylthio analogues of primaquine as potential antimalarials.,  20  (10): [PMID:409843] [10.1021/jm00220a025]

Source