The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
ethyl 4-(6-(1-methyl-5-nitro-1H-imidazol-2-ylthio)hexyloxy)-3-nitrobenzoate ID: ALA3274645
PubChem CID: 12381189
Max Phase: Preclinical
Molecular Formula: C19H24N4O7S
Molecular Weight: 452.49
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CCOC(=O)c1ccc(OCCCCCCSc2ncc([N+](=O)[O-])n2C)c([N+](=O)[O-])c1
Standard InChI: InChI=1S/C19H24N4O7S/c1-3-29-18(24)14-8-9-16(15(12-14)22(25)26)30-10-6-4-5-7-11-31-19-20-13-17(21(19)2)23(27)28/h8-9,12-13H,3-7,10-11H2,1-2H3
Standard InChI Key: YMQCWKXXUWRTFN-UHFFFAOYSA-N
Molfile:
RDKit 2D
31 32 0 0 0 0 0 0 0 0999 V2000
10.2865 -4.0648 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.0030 -3.6719 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.6992 -4.0978 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.4152 -3.7056 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.4337 -2.8877 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.7302 -2.4637 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.0170 -2.8584 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.1506 -2.4911 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.8497 -2.9142 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.1675 -1.6741 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.3342 -4.1828 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7221 -4.8969 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5216 -4.7475 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.6251 -3.9406 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8892 -3.5941 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.1157 -5.3085 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3416 -3.5476 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
6.0401 -3.9717 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7567 -3.5788 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4552 -4.0029 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1717 -3.6100 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3719 -5.6383 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.8353 -6.3114 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.5573 -5.7031 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.8703 -4.0341 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.5868 -3.6412 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3128 -2.4366 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.5980 -2.8326 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.3273 -1.6196 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.5657 -2.5204 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.2648 -2.9436 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 2 0
3 4 1 0
4 5 2 0
5 6 1 0
6 7 2 0
7 2 1 0
8 9 1 0
8 10 2 0
5 8 1 0
12 13 1 0
11 12 2 0
13 14 1 0
14 15 2 0
15 11 1 0
13 16 1 0
14 17 1 0
17 18 1 0
18 19 1 0
19 20 1 0
20 21 1 0
22 23 2 0
22 24 1 0
12 22 1 0
21 25 1 0
25 26 1 0
26 1 1 0
27 28 2 0
27 29 1 0
7 27 1 0
9 30 1 0
30 31 1 0
M CHG 4 22 1 24 -1 27 1 29 -1
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 452.49Molecular Weight (Monoisotopic): 452.1366AlogP: 4.14#Rotatable Bonds: 13Polar Surface Area: 139.63Molecular Species: NEUTRALHBA: 10HBD: ┄#RO5 Violations: ┄HBA (Lipinski): 11HBD (Lipinski): ┄#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 1.06CX LogP: 4.73CX LogD: 4.73Aromatic Rings: 2Heavy Atoms: 31QED Weighted: 0.14Np Likeness Score: -1.41
References 1. Tweit RC, Muir RD, Ziecina S.. (1977) Nitroimidazoles with antibacterial activity against Neisseria gonorrhoeae., 20 (12): [PMID:412966 ] [10.1021/jm00222a036 ]