The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
ethyl 4-(10-(1-methyl-5-nitro-1H-imidazol-2-ylthio)decyloxy)-3-nitrobenzoate ID: ALA3274649
PubChem CID: 12381192
Max Phase: Preclinical
Molecular Formula: C23H32N4O7S
Molecular Weight: 508.60
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CCOC(=O)c1ccc(OCCCCCCCCCCSc2ncc([N+](=O)[O-])n2C)c([N+](=O)[O-])c1
Standard InChI: InChI=1S/C23H32N4O7S/c1-3-33-22(28)18-12-13-20(19(16-18)26(29)30)34-14-10-8-6-4-5-7-9-11-15-35-23-24-17-21(25(23)2)27(31)32/h12-13,16-17H,3-11,14-15H2,1-2H3
Standard InChI Key: RFHYJNLYURHLTD-UHFFFAOYSA-N
Molfile:
RDKit 2D
35 36 0 0 0 0 0 0 0 0999 V2000
11.9227 -9.7324 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.6393 -9.3395 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.3354 -9.7654 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.0515 -9.3732 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.0700 -8.5554 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.3664 -8.1313 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.6533 -8.5260 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.7868 -8.1587 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.4859 -8.5819 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.8038 -7.3417 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.1414 -9.7876 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5293 -10.5017 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3288 -10.3522 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.4323 -9.5453 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6965 -9.1988 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.9229 -10.9133 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1488 -9.1524 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
4.8474 -9.5765 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5639 -9.1836 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2624 -9.6077 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9790 -9.2148 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1791 -11.2431 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.6425 -11.9161 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.3645 -11.3079 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.6775 -9.6389 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3941 -9.2460 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0926 -9.6701 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.8091 -9.2772 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.5077 -9.7013 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.2242 -9.3083 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.9508 -8.1021 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.2359 -8.4981 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.9652 -7.2851 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.2020 -8.1880 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.9011 -8.6112 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 2 0
3 4 1 0
4 5 2 0
5 6 1 0
6 7 2 0
7 2 1 0
8 9 1 0
8 10 2 0
5 8 1 0
12 13 1 0
11 12 2 0
13 14 1 0
14 15 2 0
15 11 1 0
13 16 1 0
14 17 1 0
17 18 1 0
18 19 1 0
19 20 1 0
20 21 1 0
22 23 2 0
22 24 1 0
12 22 1 0
21 25 1 0
25 26 1 0
26 27 1 0
27 28 1 0
28 29 1 0
29 30 1 0
30 1 1 0
31 32 2 0
31 33 1 0
7 31 1 0
9 34 1 0
34 35 1 0
M CHG 4 22 1 24 -1 31 1 33 -1
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 508.60Molecular Weight (Monoisotopic): 508.1992AlogP: 5.71#Rotatable Bonds: 17Polar Surface Area: 139.63Molecular Species: NEUTRALHBA: 10HBD: ┄#RO5 Violations: 2HBA (Lipinski): 11HBD (Lipinski): ┄#RO5 Violations (Lipinski): 3CX Acidic pKa: ┄CX Basic pKa: 1.06CX LogP: 6.51CX LogD: 6.51Aromatic Rings: 2Heavy Atoms: 35QED Weighted: 0.09Np Likeness Score: -1.25
References 1. Tweit RC, Muir RD, Ziecina S.. (1977) Nitroimidazoles with antibacterial activity against Neisseria gonorrhoeae., 20 (12): [PMID:412966 ] [10.1021/jm00222a036 ]