The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
7,8-Dihydro-10-oxafolic acid ID: ALA3275223
PubChem CID: 136504164
Max Phase: Preclinical
Molecular Formula: C19H20N6O7
Molecular Weight: 444.40
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: Nc1nc(=O)c2c([nH]1)NCC(COc1ccc(C(=O)N[C@@H](CCC(=O)O)C(=O)O)cc1)=N2
Standard InChI: InChI=1S/C19H20N6O7/c20-19-24-15-14(17(29)25-19)22-10(7-21-15)8-32-11-3-1-9(2-4-11)16(28)23-12(18(30)31)5-6-13(26)27/h1-4,12H,5-8H2,(H,23,28)(H,26,27)(H,30,31)(H4,20,21,24,25,29)/t12-/m0/s1
Standard InChI Key: PNAHURXYZLFRPS-LBPRGKRZSA-N
Molfile:
RDKit 2D
32 34 0 0 0 0 0 0 0 0999 V2000
4.1568 -5.0374 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.1556 -5.8647 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8705 -6.2776 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.8687 -4.6246 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5840 -5.0337 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5847 -5.8605 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.3001 -6.2715 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.0150 -5.8567 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0103 -5.0268 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2944 -4.6195 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.4409 -6.2767 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.7222 -4.6099 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.4392 -5.0181 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.1511 -4.6012 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.8658 -5.0128 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.5773 -4.5967 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.5726 -3.7708 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.8507 -3.3629 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.1422 -3.7814 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.2840 -3.3531 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.0015 -3.7602 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.2779 -2.5281 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.7129 -3.3425 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.4304 -3.7496 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.7068 -2.5175 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.4182 -2.0997 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.9893 -2.1103 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.4365 -4.5746 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.1540 -4.9817 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.1601 -5.8067 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.8654 -4.5640 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.8661 -3.7996 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 6 1 0
5 4 1 0
4 1 1 0
5 6 2 0
6 7 1 0
7 8 1 0
8 9 1 0
9 10 2 0
10 5 1 0
2 11 1 0
9 12 1 0
12 13 1 0
13 14 1 0
14 15 2 0
15 16 1 0
16 17 2 0
17 18 1 0
18 19 2 0
19 14 1 0
17 20 1 0
20 21 1 0
20 22 2 0
23 21 1 6
23 24 1 0
23 25 1 0
25 26 1 0
25 27 2 0
24 28 1 0
28 29 1 0
29 30 1 0
29 31 2 0
4 32 2 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 444.40Molecular Weight (Monoisotopic): 444.1393AlogP: -0.02#Rotatable Bonds: 9Polar Surface Area: 209.09Molecular Species: ACIDHBA: 9HBD: 6#RO5 Violations: 1HBA (Lipinski): 13HBD (Lipinski): 7#RO5 Violations (Lipinski): 2CX Acidic pKa: 2.93CX Basic pKa: 3.53CX LogP: -2.02CX LogD: -7.82Aromatic Rings: 2Heavy Atoms: 32QED Weighted: 0.30Np Likeness Score: -0.01
References 1. Nair MG, Campbell PT.. (1976) Folate analogues altered in the C9-N10 bridge region. 10-Oxafolic acid and 10-oxaaminopterin., 19 (6): [PMID:820858 ] [10.1021/jm00228a018 ]