The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
7,8-dihydrohomofolic acid ID: ALA3275224
PubChem CID: 135720406
Max Phase: Preclinical
Molecular Formula: C20H23N7O6
Molecular Weight: 457.45
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: Nc1nc(=O)c2c([nH]1)NCC(CCNc1ccc(C(=O)N[C@@H](CCC(=O)O)C(=O)O)cc1)=N2
Standard InChI: InChI=1S/C20H23N7O6/c21-20-26-16-15(18(31)27-20)24-12(9-23-16)7-8-22-11-3-1-10(2-4-11)17(30)25-13(19(32)33)5-6-14(28)29/h1-4,13,22H,5-9H2,(H,25,30)(H,28,29)(H,32,33)(H4,21,23,26,27,31)/t13-/m0/s1
Standard InChI Key: VEBDSVCWCXWVOS-ZDUSSCGKSA-N
Molfile:
RDKit 2D
33 35 0 0 0 0 0 0 0 0999 V2000
21.7105 -11.5071 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.2965 -11.5018 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
21.0028 -11.9151 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.9974 -12.7323 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.7037 -13.1414 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.6983 -13.9586 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.9906 -14.3666 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
22.4046 -14.3719 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
21.7118 -10.6899 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
22.4168 -11.9204 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
19.5847 -11.9098 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.8783 -11.4965 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.1706 -11.9003 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.4643 -11.4912 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.4656 -10.6740 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.1774 -10.2660 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.8838 -10.6793 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.5833 -12.7270 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.7634 -10.2607 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
16.0516 -10.6687 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.3452 -10.2554 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.5062 -11.8750 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.7999 -11.4658 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.8053 -10.6486 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
12.5171 -10.2406 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.2235 -10.6539 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.9312 -10.2500 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
14.6375 -10.6592 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.6321 -11.4764 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.9244 -11.8844 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
13.2180 -11.4711 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.5185 -9.4234 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.0922 -11.8697 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3 2 1 6
1 3 1 0
3 4 1 0
4 5 1 0
5 6 1 0
6 7 2 0
6 8 1 0
1 9 2 0
1 10 1 0
11 12 1 0
12 13 1 0
13 14 2 0
14 15 1 0
15 16 2 0
16 17 1 0
12 17 2 0
11 18 2 0
20 21 1 0
22 23 1 0
23 24 2 0
24 25 1 0
25 26 1 0
26 27 1 0
27 28 2 0
28 29 1 0
29 30 1 0
30 31 1 0
22 31 1 0
26 31 2 0
25 32 2 0
23 33 1 0
21 28 1 0
19 20 1 0
15 19 1 0
2 11 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 457.45Molecular Weight (Monoisotopic): 457.1710AlogP: 0.40#Rotatable Bonds: 10Polar Surface Area: 211.89Molecular Species: ACIDHBA: 9HBD: 7#RO5 Violations: 1HBA (Lipinski): 13HBD (Lipinski): 8#RO5 Violations (Lipinski): 2CX Acidic pKa: 2.60CX Basic pKa: 4.52CX LogP: -2.44CX LogD: -7.77Aromatic Rings: 2Heavy Atoms: 33QED Weighted: 0.26Np Likeness Score: -0.13
References 1. Nair MG, Campbell PT.. (1976) Folate analogues altered in the C9-N10 bridge region. 10-Oxafolic acid and 10-oxaaminopterin., 19 (6): [PMID:820858 ] [10.1021/jm00228a018 ]