The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
7,8-dihydro-10-thiofolic acid ID: ALA3275225
PubChem CID: 136504165
Max Phase: Preclinical
Molecular Formula: C19H20N6O6S
Molecular Weight: 460.47
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: Nc1nc(=O)c2c([nH]1)NCC(CSc1ccc(C(=O)N[C@@H](CCC(=O)O)C(=O)O)cc1)=N2
Standard InChI: InChI=1S/C19H20N6O6S/c20-19-24-15-14(17(29)25-19)22-10(7-21-15)8-32-11-3-1-9(2-4-11)16(28)23-12(18(30)31)5-6-13(26)27/h1-4,12H,5-8H2,(H,23,28)(H,26,27)(H,30,31)(H4,20,21,24,25,29)/t12-/m0/s1
Standard InChI Key: KPENJEPBRSFIHQ-LBPRGKRZSA-N
Molfile:
RDKit 2D
32 34 0 0 0 0 0 0 0 0999 V2000
5.5027 -5.6498 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.5014 -6.4772 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2163 -6.8901 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.2145 -5.2370 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9298 -5.6462 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9305 -6.4730 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6459 -6.8840 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.3608 -6.4692 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3561 -5.6392 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6402 -5.2321 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.7867 -6.8891 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.0680 -5.2224 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.7850 -5.6306 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
10.4969 -5.2137 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.2116 -5.6253 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.9231 -5.2092 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.9184 -4.3833 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.1965 -3.9753 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.4880 -4.3939 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.6299 -3.9655 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.3473 -4.3727 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
12.6237 -3.1406 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.0587 -3.9549 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.7762 -4.3621 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.0526 -3.1300 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.7640 -2.7122 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.3351 -2.7228 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.7823 -5.1871 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.4999 -5.5942 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.5059 -6.4192 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.2112 -5.1765 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.2120 -4.4121 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 6 1 0
5 4 1 0
4 1 1 0
5 6 2 0
6 7 1 0
7 8 1 0
8 9 1 0
9 10 2 0
10 5 1 0
2 11 1 0
9 12 1 0
12 13 1 0
13 14 1 0
14 15 2 0
15 16 1 0
16 17 2 0
17 18 1 0
18 19 2 0
19 14 1 0
17 20 1 0
20 21 1 0
20 22 2 0
23 21 1 6
23 24 1 0
23 25 1 0
25 26 1 0
25 27 2 0
24 28 1 0
28 29 1 0
29 30 1 0
29 31 2 0
4 32 2 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 460.47Molecular Weight (Monoisotopic): 460.1165AlogP: 0.69#Rotatable Bonds: 9Polar Surface Area: 199.86Molecular Species: ACIDHBA: 9HBD: 6#RO5 Violations: 1HBA (Lipinski): 12HBD (Lipinski): 7#RO5 Violations (Lipinski): 2CX Acidic pKa: 2.99CX Basic pKa: 3.55CX LogP: -1.49CX LogD: -7.30Aromatic Rings: 2Heavy Atoms: 32QED Weighted: 0.29Np Likeness Score: -0.19
References 1. Nair MG, Campbell PT.. (1976) Folate analogues altered in the C9-N10 bridge region. 10-Oxafolic acid and 10-oxaaminopterin., 19 (6): [PMID:820858 ] [10.1021/jm00228a018 ]