The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
3-(2-(biphenyl-4-yl)-2-(hydroxyimino)ethyl)-5-((4-ethyl-5-oxotetrahydrofuran-3-yl)methyl)-1-methyl-1H-imidazol-3-ium chloride ID: ALA3275305
PubChem CID: 90678992
Max Phase: Preclinical
Molecular Formula: C25H28ClN3O3
Molecular Weight: 418.52
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CCC1C(=O)OCC1Cc1c[n+](C/C(=N\O)c2ccc(-c3ccccc3)cc2)cn1C.[Cl-]
Standard InChI: InChI=1S/C25H27N3O3.ClH/c1-3-23-21(16-31-25(23)29)13-22-14-28(17-27(22)2)15-24(26-30)20-11-9-19(10-12-20)18-7-5-4-6-8-18;/h4-12,14,17,21,23H,3,13,15-16H2,1-2H3;1H/b26-24+;
Standard InChI Key: NKDREJNKQHMSKF-DVNIKIMTSA-N
Molfile:
RDKit 2D
32 34 0 0 0 0 0 0 0 0999 V2000
21.7387 -16.1262 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
16.9051 -16.8845 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.7223 -16.8845 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
17.9767 -16.1078 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.3137 -15.6257 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
16.6550 -16.1078 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.8776 -15.8556 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.2706 -16.4027 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.4718 -16.2299 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.0635 -16.9378 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.6106 -17.5449 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.3569 -17.2121 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.2508 -17.0236 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.1406 -15.4828 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.6219 -14.8225 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.2018 -17.5462 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.8686 -18.2924 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.3124 -14.8085 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.0558 -18.3768 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
18.3482 -18.9540 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.0103 -19.6973 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.4891 -20.3586 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.3029 -20.2745 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.6354 -19.5234 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.1546 -18.8653 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.7816 -20.9323 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.4476 -21.6793 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.9273 -22.3400 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.7410 -22.2548 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.0725 -21.5032 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.5908 -20.8458 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.5762 -17.7152 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 1 0
6 2 2 0
6 7 1 0
7 8 1 0
8 9 1 0
9 10 1 0
10 11 1 0
11 12 1 0
12 8 1 0
10 13 2 0
9 14 1 0
14 15 1 0
3 16 1 0
16 17 1 0
5 18 1 0
17 19 2 0
17 20 1 0
20 21 2 0
21 22 1 0
22 23 2 0
23 24 1 0
24 25 2 0
25 20 1 0
26 27 2 0
27 28 1 0
28 29 2 0
29 30 1 0
30 31 2 0
31 26 1 0
23 26 1 0
19 32 1 0
M CHG 2 1 -1 3 1
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 418.52Molecular Weight (Monoisotopic): 418.2125AlogP: 3.60#Rotatable Bonds: 7Polar Surface Area: 67.70Molecular Species: ACIDHBA: 5HBD: 1#RO5 Violations: ┄HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: 5.33CX Basic pKa: 1.09CX LogP: 0.29CX LogD: -0.84Aromatic Rings: 3Heavy Atoms: 31QED Weighted: 0.21Np Likeness Score: 0.53
References 1. Ben-Bassat AA, Lavie D.. (1976) Quaternary pilocarpine derivatives as potential acetylcholine antagonists. 2. Alterations in the lactone and imidazole moieties., 19 (7): [PMID:940111 ] [10.1021/jm00229a014 ]