The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
5-(3-(hydroxycarbamoyl)-2-(hydroxymethyl)pentyl)-1-methyl-3-(2-(4-nitrophenyl)-2-oxoethyl)-1H-imidazol-3-ium bromide ID: ALA3275307
PubChem CID: 90678995
Max Phase: Preclinical
Molecular Formula: C19H25BrN4O6
Molecular Weight: 405.43
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CCC(C(=O)NO)C(CO)Cc1c[n+](CC(=O)c2ccc([N+](=O)[O-])cc2)cn1C.[Br-]
Standard InChI: InChI=1S/C19H24N4O6.BrH/c1-3-17(19(26)20-27)14(11-24)8-16-9-22(12-21(16)2)10-18(25)13-4-6-15(7-5-13)23(28)29;/h4-7,9,12,14,17,24H,3,8,10-11H2,1-2H3,(H-,20,26,27);1H
Standard InChI Key: KYMGXZIXGVCOCT-UHFFFAOYSA-N
Molfile:
RDKit 2D
30 30 0 0 0 0 0 0 0 0999 V2000
36.6397 -19.7625 0.0000 Br 0 0 0 0 0 0 0 0 0 0 0 0
31.4371 -17.8462 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.2543 -17.8462 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
32.5086 -17.0695 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.8457 -16.5873 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
31.1869 -17.0695 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.4096 -16.8173 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.8026 -17.3644 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.7338 -18.5078 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.4006 -19.2540 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.8444 -15.7701 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.8801 -19.9157 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.5423 -20.6590 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.0211 -21.3202 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.8348 -21.2361 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.1674 -20.4850 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.6865 -19.8269 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.5878 -19.3385 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
34.3153 -21.8972 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
29.0253 -17.1122 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.9728 -18.1636 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.3658 -18.7107 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
28.4182 -17.6593 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.6409 -17.4071 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
28.5885 -18.4585 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
28.8550 -16.3129 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.4620 -15.7658 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.0339 -17.9542 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
35.1299 -21.8138 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
33.9849 -22.6460 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 1 0
6 2 2 0
6 7 1 0
7 8 1 0
3 9 1 0
9 10 1 0
5 11 1 0
10 12 1 0
12 13 2 0
13 14 1 0
14 15 2 0
15 16 1 0
16 17 2 0
17 12 1 0
10 18 2 0
15 19 1 0
8 20 1 0
8 21 1 0
21 22 1 0
20 23 1 0
23 24 1 0
23 25 2 0
20 26 1 0
26 27 1 0
24 28 1 0
19 29 2 0
19 30 1 0
M CHG 4 1 -1 3 1 19 1 30 -1
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 405.43Molecular Weight (Monoisotopic): 405.1769AlogP: 0.79#Rotatable Bonds: 10Polar Surface Area: 138.58Molecular Species: NEUTRALHBA: 7HBD: 3#RO5 Violations: ┄HBA (Lipinski): 10HBD (Lipinski): 3#RO5 Violations (Lipinski): ┄CX Acidic pKa: 8.87CX Basic pKa: ┄CX LogP: -2.90CX LogD: -2.91Aromatic Rings: 2Heavy Atoms: 29QED Weighted: 0.18Np Likeness Score: -0.23
References 1. Ben-Bassat AA, Lavie D.. (1976) Quaternary pilocarpine derivatives as potential acetylcholine antagonists. 2. Alterations in the lactone and imidazole moieties., 19 (7): [PMID:940111 ] [10.1021/jm00229a014 ]