The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
3-(3,4-dichlorobenzyl)-5-(3-(hydroxycarbamoyl)-2-(hydroxymethyl)pentyl)-1-methyl-1H-imidazol-3-ium chloride ID: ALA3275309
PubChem CID: 90678999
Max Phase: Preclinical
Molecular Formula: C18H24Cl3N3O3
Molecular Weight: 401.31
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CCC(C(=O)NO)C(CO)Cc1c[n+](Cc2ccc(Cl)c(Cl)c2)cn1C.[Cl-]
Standard InChI: InChI=1S/C18H23Cl2N3O3.ClH/c1-3-15(18(25)21-26)13(10-24)7-14-9-23(11-22(14)2)8-12-4-5-16(19)17(20)6-12;/h4-6,9,11,13,15,24H,3,7-8,10H2,1-2H3,(H-,21,25,26);1H
Standard InChI Key: PDVGHNKWAGUTDN-UHFFFAOYSA-N
Molfile:
RDKit 2D
27 27 0 0 0 0 0 0 0 0999 V2000
15.2330 -26.0170 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
12.1258 -25.4279 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.9430 -25.4279 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
13.1973 -24.6512 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.5344 -24.1691 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.8756 -24.6512 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.0983 -24.3990 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.4913 -24.9461 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.4225 -26.0896 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.0893 -26.8357 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.5331 -23.3519 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.7140 -24.6939 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.6615 -25.7453 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.0545 -26.2924 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.1069 -25.2410 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3296 -24.9888 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.2772 -26.0402 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.5437 -23.8946 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.1507 -23.3476 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7226 -25.5359 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.2754 -26.9157 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.9421 -27.6610 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.4219 -28.3237 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.2386 -28.2361 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.5681 -27.4906 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.7205 -28.8961 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
12.0896 -29.0703 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 1 0
6 2 2 0
6 7 1 0
7 8 1 0
3 9 1 0
9 10 1 0
5 11 1 0
8 12 1 0
8 13 1 0
13 14 1 0
12 15 1 0
15 16 1 0
15 17 2 0
12 18 1 0
18 19 1 0
16 20 1 0
10 21 2 0
21 22 1 0
22 23 2 0
23 24 1 0
24 25 2 0
25 10 1 0
24 26 1 0
23 27 1 0
M CHG 2 1 -1 3 1
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 401.31Molecular Weight (Monoisotopic): 400.1189AlogP: 2.35#Rotatable Bonds: 8Polar Surface Area: 78.37Molecular Species: NEUTRALHBA: 4HBD: 3#RO5 Violations: ┄HBA (Lipinski): 6HBD (Lipinski): 3#RO5 Violations (Lipinski): ┄CX Acidic pKa: 8.87CX Basic pKa: ┄CX LogP: -1.14CX LogD: -1.15Aromatic Rings: 2Heavy Atoms: 26QED Weighted: 0.36Np Likeness Score: -0.07
References 1. Ben-Bassat AA, Lavie D.. (1976) Quaternary pilocarpine derivatives as potential acetylcholine antagonists. 2. Alterations in the lactone and imidazole moieties., 19 (7): [PMID:940111 ] [10.1021/jm00229a014 ]