3-ethyl-5-(3-(hydroxycarbamoyl)-2-(hydroxymethyl)pentyl)-1-methyl-1H-imidazol-3-ium Iodide

ID: ALA3275311

PubChem CID: 90679003

Max Phase: Preclinical

Molecular Formula: C13H24IN3O3

Molecular Weight: 270.35

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CCC(C(=O)NO)C(CO)Cc1c[n+](CC)cn1C.[I-]

Standard InChI:  InChI=1S/C13H23N3O3.HI/c1-4-12(13(18)14-19)10(8-17)6-11-7-16(5-2)9-15(11)3;/h7,9-10,12,17H,4-6,8H2,1-3H3,(H-,14,18,19);1H

Standard InChI Key:  CYNKGZKVADDQRG-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 20 19  0  0  0  0  0  0  0  0999 V2000
   29.8473  -23.9839    0.0000 I   0  0  0  0  0  0  0  0  0  0  0  0
   27.7349  -24.6644    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.5521  -24.6644    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   28.8065  -23.8876    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.1435  -23.4055    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   27.4848  -23.8876    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.7075  -23.6355    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.1004  -24.1825    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.0317  -25.3260    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.6984  -26.0722    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.1423  -22.5883    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.3231  -23.9304    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.2707  -24.9818    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.6637  -25.5289    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   24.7161  -24.4774    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.9388  -24.2253    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   24.8864  -25.2767    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   25.1529  -23.1311    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.7599  -22.5840    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.3317  -24.7724    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  1  0
  6  2  2  0
  6  7  1  0
  7  8  1  0
  3  9  1  0
  9 10  1  0
  5 11  1  0
  8 12  1  0
  8 13  1  0
 13 14  1  0
 12 15  1  0
 15 16  1  0
 15 17  2  0
 12 18  1  0
 18 19  1  0
 16 20  1  0
M  CHG  2   1  -1   3   1
M  END

Associated Targets(non-human)

Ileum (856 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 270.35Molecular Weight (Monoisotopic): 270.1812AlogP: 0.02#Rotatable Bonds: 7
Polar Surface Area: 78.37Molecular Species: NEUTRALHBA: 4HBD: 3
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 3#RO5 Violations (Lipinski):
CX Acidic pKa: 8.87CX Basic pKa: CX LogP: -3.72CX LogD: -3.73
Aromatic Rings: 1Heavy Atoms: 19QED Weighted: 0.37Np Likeness Score: 0.56

References

1. Ben-Bassat AA, Lavie D..  (1976)  Quaternary pilocarpine derivatives as potential acetylcholine antagonists. 2. Alterations in the lactone and imidazole moieties.,  19  (7): [PMID:940111] [10.1021/jm00229a014]

Source