The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
3-(2-(4-bromophenyl)-2-(hydroxyimino)ethyl)-5-(3-(hydroxycarbamoyl)-2-(hydroxymethyl)pentyl)-1-methyl-1H-imidazol-3-ium bromide ID: ALA3275312
PubChem CID: 90679005
Max Phase: Preclinical
Molecular Formula: C19H26Br2N4O4
Molecular Weight: 454.35
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CCC(C(=O)NO)C(CO)Cc1c[n+](C/C(=N\O)c2ccc(Br)cc2)cn1C.[Br-]
Standard InChI: InChI=1S/C19H25BrN4O4.BrH/c1-3-17(19(26)22-28)14(11-25)8-16-9-24(12-23(16)2)10-18(21-27)13-4-6-15(20)7-5-13;/h4-7,9,12,14,17,25H,3,8,10-11H2,1-2H3,(H2-,22,26,27,28);1H/b21-18+;
Standard InChI Key: XQLDHUSNFBQTQU-GOSREXKOSA-N
Molfile:
RDKit 2D
29 29 0 0 0 0 0 0 0 0999 V2000
13.7900 -33.2921 0.0000 Br 0 0 0 0 0 0 0 0 0 0 0 0
9.7485 -31.6435 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.5657 -31.6435 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.8200 -30.8668 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.1571 -30.3847 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.4983 -30.8668 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.7210 -30.6146 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1140 -31.1617 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.0452 -32.3052 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.7120 -33.0513 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.1558 -29.5675 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.1915 -33.7130 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.8537 -34.4563 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.3325 -35.1176 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.1462 -35.0334 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.4788 -34.2824 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.9980 -33.6242 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.8992 -33.1358 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
12.6267 -35.6945 0.0000 Br 0 0 0 0 0 0 0 0 0 0 0 0
7.3367 -30.9095 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2842 -31.9609 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6772 -32.5080 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.7296 -31.4566 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9523 -31.2044 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.8999 -32.2558 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.1664 -30.1103 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7735 -29.5632 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3453 -31.7515 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.4196 -32.4741 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 1 0
6 2 2 0
6 7 1 0
7 8 1 0
3 9 1 0
9 10 1 0
5 11 1 0
10 12 1 0
12 13 2 0
13 14 1 0
14 15 2 0
15 16 1 0
16 17 2 0
17 12 1 0
10 18 2 0
15 19 1 0
8 20 1 0
8 21 1 0
21 22 1 0
20 23 1 0
23 24 1 0
23 25 2 0
20 26 1 0
26 27 1 0
24 28 1 0
18 29 1 0
M CHG 2 1 -1 3 1
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 454.35Molecular Weight (Monoisotopic): 453.1132AlogP: 1.64#Rotatable Bonds: 9Polar Surface Area: 110.96Molecular Species: ACIDHBA: 6HBD: 4#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 4#RO5 Violations (Lipinski): ┄CX Acidic pKa: 4.68CX Basic pKa: 0.42CX LogP: -2.06CX LogD: -3.24Aromatic Rings: 2Heavy Atoms: 28QED Weighted: 0.15Np Likeness Score: 0.06
References 1. Ben-Bassat AA, Lavie D.. (1976) Quaternary pilocarpine derivatives as potential acetylcholine antagonists. 2. Alterations in the lactone and imidazole moieties., 19 (7): [PMID:940111 ] [10.1021/jm00229a014 ]