The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
5-(3-(hydroxycarbamoyl)-2-(hydroxymethyl)pentyl)-3-(2-(hydroxyimino)-2-(4-nitrophenyl)ethyl)-1-methyl-1H-imidazol-3-ium bromide ID: ALA3275313
PubChem CID: 90679007
Max Phase: Preclinical
Molecular Formula: C19H26BrN5O6
Molecular Weight: 420.45
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CCC(C(=O)NO)C(CO)Cc1c[n+](C/C(=N\O)c2ccc([N+](=O)[O-])cc2)cn1C.[Br-]
Standard InChI: InChI=1S/C19H25N5O6.BrH/c1-3-17(19(26)21-28)14(11-25)8-16-9-23(12-22(16)2)10-18(20-27)13-4-6-15(7-5-13)24(29)30;/h4-7,9,12,14,17,25H,3,8,10-11H2,1-2H3,(H2-,21,26,27,28);1H/b20-18+;
Standard InChI Key: JCNHDTHHWSGFEH-KPJFUTMLSA-N
Molfile:
RDKit 2D
31 31 0 0 0 0 0 0 0 0999 V2000
22.4225 -31.2017 0.0000 Br 0 0 0 0 0 0 0 0 0 0 0 0
18.8077 -30.6612 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.6249 -30.6612 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
19.8793 -29.8845 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.2163 -29.4024 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
18.5576 -29.8845 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.7803 -29.6323 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.1733 -30.1794 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.1045 -31.3229 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.7713 -32.0690 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.2151 -28.5852 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.2508 -32.7307 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.9130 -33.4740 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.3918 -34.1353 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.2055 -34.0512 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.5381 -33.3001 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.0572 -32.6419 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.9584 -32.1535 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
21.6860 -34.7122 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
16.3959 -29.9272 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.3435 -30.9787 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.7365 -31.5257 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.7889 -30.4743 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.0116 -30.2221 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
15.9592 -31.2736 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.2257 -29.1280 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.8327 -28.5809 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.4045 -30.7692 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
18.4789 -31.4918 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
22.5006 -34.6289 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
21.3556 -35.4610 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 1 0
6 2 2 0
6 7 1 0
7 8 1 0
3 9 1 0
9 10 1 0
5 11 1 0
10 12 1 0
12 13 2 0
13 14 1 0
14 15 2 0
15 16 1 0
16 17 2 0
17 12 1 0
10 18 2 0
15 19 1 0
8 20 1 0
8 21 1 0
21 22 1 0
20 23 1 0
23 24 1 0
23 25 2 0
20 26 1 0
26 27 1 0
24 28 1 0
18 29 1 0
19 30 2 0
19 31 1 0
M CHG 4 1 -1 3 1 19 1 31 -1
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 420.45Molecular Weight (Monoisotopic): 420.1878AlogP: 0.78#Rotatable Bonds: 10Polar Surface Area: 154.10Molecular Species: ACIDHBA: 8HBD: 4#RO5 Violations: ┄HBA (Lipinski): 11HBD (Lipinski): 4#RO5 Violations (Lipinski): 1CX Acidic pKa: 6.36CX Basic pKa: 0.14CX LogP: -2.89CX LogD: -3.74Aromatic Rings: 2Heavy Atoms: 30QED Weighted: 0.11Np Likeness Score: -0.19
References 1. Ben-Bassat AA, Lavie D.. (1976) Quaternary pilocarpine derivatives as potential acetylcholine antagonists. 2. Alterations in the lactone and imidazole moieties., 19 (7): [PMID:940111 ] [10.1021/jm00229a014 ]