2-(3-(4-chlorophenyl)-3-hydroxy-2,3-dihydrobenzo[d]thiazolo[3,2-a]imidazol-2-yl)acetic acid

ID: ALA3276261

Cas Number: 39225-26-8

PubChem CID: 162367

Max Phase: Preclinical

Molecular Formula: C17H13ClN2O3S

Molecular Weight: 360.82

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  O=C(O)CC1Sc2nc3ccccc3n2C1(O)c1ccc(Cl)cc1

Standard InChI:  InChI=1S/C17H13ClN2O3S/c18-11-7-5-10(6-8-11)17(23)14(9-15(21)22)24-16-19-12-3-1-2-4-13(12)20(16)17/h1-8,14,23H,9H2,(H,21,22)

Standard InChI Key:  JMBHHZBJVMEEAP-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 24 27  0  0  0  0  0  0  0  0999 V2000
    5.1747   -5.7074    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.7345   -5.7540    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    5.9466   -5.9833    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9224   -6.8042    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.6959   -7.0801    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.1962   -6.4280    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.2784   -7.7814    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.3986   -7.4902    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.4613   -7.7678    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0440   -8.4682    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4427   -9.1814    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.2630   -9.1897    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.6766   -8.4886    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.0131   -6.4501    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4406   -5.7536    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.2575   -5.7757    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.0512   -5.0351    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.1343   -7.0354    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6734   -6.3602    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8601   -6.4226    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5067   -7.1596    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9726   -7.8351    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7843   -7.7694    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0256   -9.8841    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
  1 19  1  0
 18  4  1  0
  3  1  2  0
  3  4  1  0
  2  3  1  0
  4  5  1  0
  5  6  1  0
  6  2  1  0
  5  7  1  0
  5  8  1  0
  7  9  2  0
  9 10  1  0
 10 11  2  0
 11 12  1  0
 12 13  2  0
 13  7  1  0
  6 14  1  0
 14 15  1  0
 15 16  2  0
 15 17  1  0
 18 19  2  0
 19 20  1  0
 20 21  2  0
 21 22  1  0
 22 23  2  0
 23 18  1  0
 11 24  1  0
M  END

Associated Targets(non-human)

Lewis lung carcinoma cell line (1243 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 360.82Molecular Weight (Monoisotopic): 360.0335AlogP: 3.33#Rotatable Bonds: 3
Polar Surface Area: 75.35Molecular Species: ACIDHBA: 5HBD: 2
#RO5 Violations: HBA (Lipinski): 5HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 4.21CX Basic pKa: 3.56CX LogP: 3.73CX LogD: 1.05
Aromatic Rings: 3Heavy Atoms: 24QED Weighted: 0.75Np Likeness Score: -0.42

References

1. Bell SC, Wei PH..  (1976)  Syntheses of heterocylic fused thiazole acetic acids. 2.,  19  (4): [PMID:1263204] [10.1021/jm00226a016]

Source