7(8->11alpha)abeo-19-Nor-10-isopregn-1-ene-3,20-dione

ID: ALA3276480

PubChem CID: 90679521

Max Phase: Preclinical

Molecular Formula: C20H28O2

Molecular Weight: 300.44

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CC(=O)[C@H]1CC[C@H]2C[C@@H]3[C@@H](CCC4CC(=O)C=C[C@H]43)C[C@@]21C

Standard InChI:  InChI=1S/C20H28O2/c1-12(21)19-8-5-15-10-18-14(11-20(15,19)2)4-3-13-9-16(22)6-7-17(13)18/h6-7,13-15,17-19H,3-5,8-11H2,1-2H3/t13?,14-,15-,17+,18+,19+,20-/m0/s1

Standard InChI Key:  JYBPNTYOXNSMLC-ABZOQJLISA-N

Molfile:  

     RDKit          2D

 26 29  0  0  0  0  0  0  0  0999 V2000
    9.7197  -10.0992    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3677  -11.5811    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3665  -12.4056    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0789  -12.8171    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7929  -12.4052    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0771  -11.1697    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7930  -11.5803    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7864   -9.9325    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0707  -10.3467    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.5024  -10.3430    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4989  -11.1703    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.2096  -11.5846    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.2167   -9.9301    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.9319  -10.3490    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.9262  -11.1754    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.7103  -11.4363    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.2008  -10.7712    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4951   -9.5174    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    8.9277   -9.5257    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6542  -12.8162    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.4910  -11.9922    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    8.9194  -11.9964    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    9.9793   -9.3191    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.7847   -9.1538    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.4334   -8.7042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7930  -10.7553    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
  2  3  1  0
  3  4  1  0
  4  5  2  0
  5  7  1  0
  6  2  1  0
  6  7  1  0
  6  9  1  0
  7 11  1  0
 10  8  1  0
  8  9  1  0
 10 11  1  0
 10 13  1  0
 11 12  1  0
 12 15  1  0
 14 13  1  0
 14 15  1  0
 15 16  1  0
 16 17  1  0
 17  1  1  0
  1 14  1  0
 10 18  1  6
 14 19  1  1
  3 20  2  0
 11 21  1  6
 15 22  1  6
  1 23  1  1
 23 24  2  0
 23 25  1  0
  7 26  1  1
M  END

Associated Targets(non-human)

PGR Progesterone receptor (449 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Oryctolagus cuniculus (11301 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 300.44Molecular Weight (Monoisotopic): 300.2089AlogP: 4.19#Rotatable Bonds: 1
Polar Surface Area: 34.14Molecular Species: NEUTRALHBA: 2HBD:
#RO5 Violations: HBA (Lipinski): 2HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: CX LogP: 3.89CX LogD: 3.89
Aromatic Rings: Heavy Atoms: 22QED Weighted: 0.73Np Likeness Score: 2.40

References

1. Wani MC, Rector DH, White DH, Pitt CG, Kimmel GL..  (1977)  Synthesis, antifertility activity, and protein binding affinity of 7(8 leads to 11 alpha)abeo steroids.,  20  (4): [PMID:850240] [10.1021/jm00214a017]

Source