N1,N1'-(2,2'-disulfanediylbis(ethane-2,1-diyl))bis(N7-benzylheptane-1,7-diamine)tetrahydrochloride

ID: ALA3277605

PubChem CID: 90679892

Max Phase: Preclinical

Molecular Formula: C32H55ClN4S2

Molecular Weight: 558.95

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  Cl.c1ccc(CNCCCCCCCNCCSSCCNCCCCCCCNCc2ccccc2)cc1

Standard InChI:  InChI=1S/C32H54N4S2.ClH/c1(5-15-23-35-29-31-17-9-7-10-18-31)3-13-21-33-25-27-37-38-28-26-34-22-14-4-2-6-16-24-36-30-32-19-11-8-12-20-32;/h7-12,17-20,33-36H,1-6,13-16,21-30H2;1H

Standard InChI Key:  VGXQEDFDHOFTJI-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 39 39  0  0  0  0  0  0  0  0999 V2000
   37.0846   -8.9123    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   24.5168  -14.4001    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.2313  -13.9876    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.9457  -14.4001    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.6602  -13.9876    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.3747  -14.4001    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.0892  -13.9876    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   28.8037  -14.4001    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.5182  -13.9876    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.2326  -14.4001    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   30.9471  -13.9876    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   23.8023  -13.9876    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.6616  -14.4001    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.3760  -13.9876    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.0905  -14.4001    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   33.8050  -13.9876    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.5194  -14.4001    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.2339  -13.9876    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.9484  -14.4001    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.6629  -13.9876    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.3774  -14.4001    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.0879  -14.4001    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.0919  -13.9876    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.3734  -13.9876    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   38.0919  -13.1626    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   22.3734  -13.1626    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.6589  -12.7501    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.8063  -12.7501    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.8063  -11.9250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.6622  -11.9240    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.9485  -11.5115    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.2330  -11.9241    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.2357  -12.7534    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.9499  -13.1621    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.5240  -11.5161    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.5244  -10.6919    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.8094  -10.2786    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.0926  -10.6955    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.0957  -11.5183    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  3  1  0
  3  4  1  0
  4  5  1  0
  5  6  1  0
  6  7  1  0
  7  8  1  0
  8  9  1  0
  9 10  1  0
 10 11  1  0
  2 12  1  0
 11 13  1  0
 13 14  1  0
 14 15  1  0
 15 16  1  0
 16 17  1  0
 17 18  1  0
 18 19  1  0
 19 20  1  0
 20 21  1  0
 12 22  1  0
 21 23  1  0
 22 24  1  0
 23 25  1  0
 24 26  1  0
 26 27  1  0
 25 28  1  0
 28 29  1  0
 27 30  2  0
 30 31  1  0
 31 32  2  0
 32 33  1  0
 33 34  2  0
 34 27  1  0
 29 35  2  0
 35 36  1  0
 36 37  2  0
 37 38  1  0
 38 39  2  0
 39 29  1  0
M  END

Associated Targets(non-human)

Adra1b Adrenergic receptor alpha (950 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 558.95Molecular Weight (Monoisotopic): 558.3790AlogP: 7.03#Rotatable Bonds: 27
Polar Surface Area: 48.12Molecular Species: BASEHBA: 6HBD: 4
#RO5 Violations: 2HBA (Lipinski): 4HBD (Lipinski): 4#RO5 Violations (Lipinski): 2
CX Acidic pKa: CX Basic pKa: 10.37CX LogP: 6.65CX LogD: -2.55
Aromatic Rings: 2Heavy Atoms: 38QED Weighted: 0.07Np Likeness Score: -0.19

References

1. Melchiorre C, Yong MS, Benfey BG, Belleau B..  (1978)  Molecular properties of the adrenergic alpha receptor. 2. Optimum covalent inhibition by two different prototypes of polyamine disulfides.,  21  (11): [PMID:31477] [10.1021/jm00209a007]

Source