The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N1,N1'-(2,2'-disulfanediylbis(ethane-2,1-diyl))bis(N7-benzylheptane-1,7-diamine)tetrahydrochloride ID: ALA3277605
PubChem CID: 90679892
Max Phase: Preclinical
Molecular Formula: C32H55ClN4S2
Molecular Weight: 558.95
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: Cl.c1ccc(CNCCCCCCCNCCSSCCNCCCCCCCNCc2ccccc2)cc1
Standard InChI: InChI=1S/C32H54N4S2.ClH/c1(5-15-23-35-29-31-17-9-7-10-18-31)3-13-21-33-25-27-37-38-28-26-34-22-14-4-2-6-16-24-36-30-32-19-11-8-12-20-32;/h7-12,17-20,33-36H,1-6,13-16,21-30H2;1H
Standard InChI Key: VGXQEDFDHOFTJI-UHFFFAOYSA-N
Molfile:
RDKit 2D
39 39 0 0 0 0 0 0 0 0999 V2000
37.0846 -8.9123 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
24.5168 -14.4001 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.2313 -13.9876 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.9457 -14.4001 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.6602 -13.9876 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.3747 -14.4001 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.0892 -13.9876 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
28.8037 -14.4001 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.5182 -13.9876 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.2326 -14.4001 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
30.9471 -13.9876 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
23.8023 -13.9876 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.6616 -14.4001 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.3760 -13.9876 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.0905 -14.4001 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
33.8050 -13.9876 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.5194 -14.4001 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.2339 -13.9876 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.9484 -14.4001 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.6629 -13.9876 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.3774 -14.4001 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.0879 -14.4001 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.0919 -13.9876 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.3734 -13.9876 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
38.0919 -13.1626 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
22.3734 -13.1626 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.6589 -12.7501 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.8063 -12.7501 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.8063 -11.9250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.6622 -11.9240 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.9485 -11.5115 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.2330 -11.9241 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.2357 -12.7534 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.9499 -13.1621 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.5240 -11.5161 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.5244 -10.6919 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.8094 -10.2786 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.0926 -10.6955 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.0957 -11.5183 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 3 1 0
3 4 1 0
4 5 1 0
5 6 1 0
6 7 1 0
7 8 1 0
8 9 1 0
9 10 1 0
10 11 1 0
2 12 1 0
11 13 1 0
13 14 1 0
14 15 1 0
15 16 1 0
16 17 1 0
17 18 1 0
18 19 1 0
19 20 1 0
20 21 1 0
12 22 1 0
21 23 1 0
22 24 1 0
23 25 1 0
24 26 1 0
26 27 1 0
25 28 1 0
28 29 1 0
27 30 2 0
30 31 1 0
31 32 2 0
32 33 1 0
33 34 2 0
34 27 1 0
29 35 2 0
35 36 1 0
36 37 2 0
37 38 1 0
38 39 2 0
39 29 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 558.95Molecular Weight (Monoisotopic): 558.3790AlogP: 7.03#Rotatable Bonds: 27Polar Surface Area: 48.12Molecular Species: BASEHBA: 6HBD: 4#RO5 Violations: 2HBA (Lipinski): 4HBD (Lipinski): 4#RO5 Violations (Lipinski): 2CX Acidic pKa: ┄CX Basic pKa: 10.37CX LogP: 6.65CX LogD: -2.55Aromatic Rings: 2Heavy Atoms: 38QED Weighted: 0.07Np Likeness Score: -0.19
References 1. Melchiorre C, Yong MS, Benfey BG, Belleau B.. (1978) Molecular properties of the adrenergic alpha receptor. 2. Optimum covalent inhibition by two different prototypes of polyamine disulfides., 21 (11): [PMID:31477 ] [10.1021/jm00209a007 ]