The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N1,N1'-(2,2'-disulfanediylbis(ethane-2,1-diyl))bis(N6-benzylhexane-1,6-diamine)tetrahydrochloride ID: ALA3277606
PubChem CID: 90679894
Max Phase: Preclinical
Molecular Formula: C30H51ClN4S2
Molecular Weight: 530.89
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: Cl.c1ccc(CNCCCCCCNCCSSCCNCCCCCCNCc2ccccc2)cc1
Standard InChI: InChI=1S/C30H50N4S2.ClH/c1(3-13-21-33-27-29-15-7-5-8-16-29)11-19-31-23-25-35-36-26-24-32-20-12-2-4-14-22-34-28-30-17-9-6-10-18-30;/h5-10,15-18,31-34H,1-4,11-14,19-28H2;1H
Standard InChI Key: OXLWMUBUHUUTPR-UHFFFAOYSA-N
Molfile:
RDKit 2D
37 37 0 0 0 0 0 0 0 0999 V2000
18.4043 -16.6377 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
2.5792 -12.9626 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2937 -12.5501 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0082 -12.9626 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7226 -12.5501 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4371 -12.9626 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1516 -12.5501 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.8660 -12.9626 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5805 -12.5501 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2950 -12.9626 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
9.0094 -12.5501 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
1.8647 -12.5501 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.7239 -12.9626 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.4384 -12.5501 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.1529 -12.9626 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.8674 -12.5501 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.5819 -12.9626 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.2963 -12.5501 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.0108 -12.9626 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.7253 -12.5501 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.4397 -12.9626 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1502 -12.9626 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
16.1542 -12.5501 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.4357 -12.5501 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.2796 -12.9626 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.8687 -12.9626 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.5831 -12.5501 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.2973 -12.9653 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.0114 -12.5535 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.0118 -11.7276 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.2923 -11.3153 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.5812 -11.7294 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.9970 -12.5504 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7086 -12.9622 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7090 -13.7881 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.9938 -14.2004 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.2799 -13.7862 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 3 1 0
3 4 1 0
4 5 1 0
5 6 1 0
6 7 1 0
7 8 1 0
8 9 1 0
9 10 1 0
10 11 1 0
2 12 1 0
11 13 1 0
13 14 1 0
14 15 1 0
15 16 1 0
16 17 1 0
17 18 1 0
18 19 1 0
19 20 1 0
20 21 1 0
12 22 1 0
21 23 1 0
22 24 1 0
24 25 1 0
23 26 1 0
26 27 1 0
27 28 2 0
28 29 1 0
29 30 2 0
30 31 1 0
31 32 2 0
32 27 1 0
25 33 2 0
33 34 1 0
34 35 2 0
35 36 1 0
36 37 2 0
37 25 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 530.89Molecular Weight (Monoisotopic): 530.3477AlogP: 6.25#Rotatable Bonds: 25Polar Surface Area: 48.12Molecular Species: BASEHBA: 6HBD: 4#RO5 Violations: 2HBA (Lipinski): 4HBD (Lipinski): 4#RO5 Violations (Lipinski): 2CX Acidic pKa: ┄CX Basic pKa: 10.37CX LogP: 5.77CX LogD: -3.44Aromatic Rings: 2Heavy Atoms: 36QED Weighted: 0.09Np Likeness Score: -0.20
References 1. Melchiorre C, Yong MS, Benfey BG, Belleau B.. (1978) Molecular properties of the adrenergic alpha receptor. 2. Optimum covalent inhibition by two different prototypes of polyamine disulfides., 21 (11): [PMID:31477 ] [10.1021/jm00209a007 ]