N1,N1'-(2,2'-disulfanediylbis(ethane-2,1-diyl))bis(N1-methyloctane-1,8-diamine)tetraoxalate

ID: ALA3277607

PubChem CID: 90679895

Max Phase: Preclinical

Molecular Formula: C24H52N4O4S2

Molecular Weight: 434.80

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CN(CCCCCCCCN)CCSSCCN(C)CCCCCCCCN.O=C(O)C(=O)O

Standard InChI:  InChI=1S/C22H50N4S2.C2H2O4/c1-25(17-13-9-5-3-7-11-15-23)19-21-27-28-22-20-26(2)18-14-10-6-4-8-12-16-24;3-1(4)2(5)6/h3-24H2,1-2H3;(H,3,4)(H,5,6)

Standard InChI Key:  LCFWBCYAXSJGBK-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 34 32  0  0  0  0  0  0  0  0999 V2000
   42.8980  -14.1398    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.4895  -14.8530    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.4895  -13.4307    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   43.7194  -14.1398    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   42.8980  -15.5621    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   41.6681  -14.8530    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   25.5085   -9.8376    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.2230   -9.4251    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.9374   -9.8376    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.6519   -9.4251    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.3664   -9.8376    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.0808   -9.4251    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   29.7953   -9.8376    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.5099   -9.4251    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.2243   -9.8376    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   31.9388   -9.4251    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   24.7940   -9.4251    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.6533   -9.8376    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.3677   -9.4251    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.0822   -9.8376    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   34.7967   -9.4251    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.5111   -9.8376    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.2256   -9.4251    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.9401   -9.8376    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.6545   -9.4251    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.3690   -9.8376    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.0796   -9.8376    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.0836   -9.4251    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.3651   -9.4251    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.6506   -9.8376    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   39.7980   -9.8376    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.5125   -9.4251    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   29.0808   -8.6001    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.0822  -10.6626    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  1  3  2  0
  1  4  1  0
  2  5  2  0
  2  6  1  0
  7  8  1  0
  8  9  1  0
  9 10  1  0
 10 11  1  0
 11 12  1  0
 12 13  1  0
 13 14  1  0
 14 15  1  0
 15 16  1  0
  7 17  1  0
 16 18  1  0
 18 19  1  0
 19 20  1  0
 20 21  1  0
 21 22  1  0
 22 23  1  0
 23 24  1  0
 24 25  1  0
 25 26  1  0
 17 27  1  0
 26 28  1  0
 27 29  1  0
 29 30  1  0
 28 31  1  0
 31 32  1  0
 12 33  1  0
 20 34  1  0
M  END

Associated Targets(non-human)

Adra1b Adrenergic receptor alpha (950 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 434.80Molecular Weight (Monoisotopic): 434.3477AlogP: 4.83#Rotatable Bonds: 23
Polar Surface Area: 58.52Molecular Species: BASEHBA: 6HBD: 2
#RO5 Violations: HBA (Lipinski): 4HBD (Lipinski): 4#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 10.54CX LogP: 4.00CX LogD: -4.50
Aromatic Rings: Heavy Atoms: 28QED Weighted: 0.18Np Likeness Score: -0.05

References

1. Melchiorre C, Yong MS, Benfey BG, Belleau B..  (1978)  Molecular properties of the adrenergic alpha receptor. 2. Optimum covalent inhibition by two different prototypes of polyamine disulfides.,  21  (11): [PMID:31477] [10.1021/jm00209a007]

Source