The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N1,N1'-(2,2'-disulfanediylbis(ethane-2,1-diyl))bis(N1-methyloctane-1,8-diamine)tetraoxalate ID: ALA3277607
PubChem CID: 90679895
Max Phase: Preclinical
Molecular Formula: C24H52N4O4S2
Molecular Weight: 434.80
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CN(CCCCCCCCN)CCSSCCN(C)CCCCCCCCN.O=C(O)C(=O)O
Standard InChI: InChI=1S/C22H50N4S2.C2H2O4/c1-25(17-13-9-5-3-7-11-15-23)19-21-27-28-22-20-26(2)18-14-10-6-4-8-12-16-24;3-1(4)2(5)6/h3-24H2,1-2H3;(H,3,4)(H,5,6)
Standard InChI Key: LCFWBCYAXSJGBK-UHFFFAOYSA-N
Molfile:
RDKit 2D
34 32 0 0 0 0 0 0 0 0999 V2000
42.8980 -14.1398 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.4895 -14.8530 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.4895 -13.4307 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
43.7194 -14.1398 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
42.8980 -15.5621 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
41.6681 -14.8530 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
25.5085 -9.8376 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.2230 -9.4251 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.9374 -9.8376 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.6519 -9.4251 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.3664 -9.8376 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.0808 -9.4251 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
29.7953 -9.8376 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.5099 -9.4251 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.2243 -9.8376 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
31.9388 -9.4251 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
24.7940 -9.4251 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.6533 -9.8376 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.3677 -9.4251 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.0822 -9.8376 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
34.7967 -9.4251 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.5111 -9.8376 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.2256 -9.4251 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.9401 -9.8376 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.6545 -9.4251 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.3690 -9.8376 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.0796 -9.8376 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.0836 -9.4251 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.3651 -9.4251 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.6506 -9.8376 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
39.7980 -9.8376 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.5125 -9.4251 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
29.0808 -8.6001 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.0822 -10.6626 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
1 3 2 0
1 4 1 0
2 5 2 0
2 6 1 0
7 8 1 0
8 9 1 0
9 10 1 0
10 11 1 0
11 12 1 0
12 13 1 0
13 14 1 0
14 15 1 0
15 16 1 0
7 17 1 0
16 18 1 0
18 19 1 0
19 20 1 0
20 21 1 0
21 22 1 0
22 23 1 0
23 24 1 0
24 25 1 0
25 26 1 0
17 27 1 0
26 28 1 0
27 29 1 0
29 30 1 0
28 31 1 0
31 32 1 0
12 33 1 0
20 34 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 434.80Molecular Weight (Monoisotopic): 434.3477AlogP: 4.83#Rotatable Bonds: 23Polar Surface Area: 58.52Molecular Species: BASEHBA: 6HBD: 2#RO5 Violations: ┄HBA (Lipinski): 4HBD (Lipinski): 4#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 10.54CX LogP: 4.00CX LogD: -4.50Aromatic Rings: ┄Heavy Atoms: 28QED Weighted: 0.18Np Likeness Score: -0.05
References 1. Melchiorre C, Yong MS, Benfey BG, Belleau B.. (1978) Molecular properties of the adrenergic alpha receptor. 2. Optimum covalent inhibition by two different prototypes of polyamine disulfides., 21 (11): [PMID:31477 ] [10.1021/jm00209a007 ]