The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
((S)-1-{(S)-1-[({[(Methoxy-methyl-carbamoyl)-methyl]-carbamoyl}-methyl)-carbamoyl]-ethylcarbamoyl}-3-methyl-butyl)-carbamic acid benzyl ester ID: ALA327965
PubChem CID: 44332637
Max Phase: Preclinical
Molecular Formula: C23H35N5O7
Molecular Weight: 493.56
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CON(C)C(=O)CNC(=O)CNC(=O)[C@H](C)NC(=O)[C@H](CC(C)C)NC(=O)OCc1ccccc1
Standard InChI: InChI=1S/C23H35N5O7/c1-15(2)11-18(27-23(33)35-14-17-9-7-6-8-10-17)22(32)26-16(3)21(31)25-12-19(29)24-13-20(30)28(4)34-5/h6-10,15-16,18H,11-14H2,1-5H3,(H,24,29)(H,25,31)(H,26,32)(H,27,33)/t16-,18-/m0/s1
Standard InChI Key: LNBWAYJIVGUVGI-WMZOPIPTSA-N
Molfile:
RDKit 2D
35 35 0 0 1 0 0 0 0 0999 V2000
3.9250 -7.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3625 -7.1042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6417 -7.0917 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.7792 -7.0667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0667 -7.0917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2125 -7.0750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4917 -7.4792 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.7875 -7.5042 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.3542 -7.5042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2167 -7.5042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.0750 -7.5167 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.6417 -7.5125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9292 -7.1000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.9167 -8.3167 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.3625 -6.2792 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.7875 -6.2417 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.0667 -6.2667 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.0667 -7.4792 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.2125 -6.2542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2125 -8.3292 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.5042 -7.0917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3542 -7.0625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.7292 -7.0167 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.3625 -7.4667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9292 -5.8417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.1250 -8.3417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3542 -8.3292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.4917 -7.3292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0750 -7.0500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3625 -8.2917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7250 -5.6292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9292 -5.0167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0750 -8.7000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7875 -7.4542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7958 -8.2875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 12 1 0
3 1 1 0
4 7 1 0
5 9 1 0
6 1 1 0
7 6 1 0
8 5 1 0
9 3 1 0
10 21 1 0
11 2 1 0
12 13 1 0
13 10 1 0
14 1 2 0
15 2 2 0
16 4 2 0
17 5 2 0
18 4 1 0
6 19 1 1
20 10 2 0
21 8 1 0
22 18 1 0
23 11 1 0
24 22 1 0
25 19 1 0
26 11 1 0
9 27 1 6
28 23 1 0
29 24 2 0
30 24 1 0
31 25 1 0
32 25 1 0
33 30 2 0
34 29 1 0
35 33 1 0
34 35 2 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 493.56Molecular Weight (Monoisotopic): 493.2536AlogP: 0.08#Rotatable Bonds: 13Polar Surface Area: 155.17Molecular Species: NEUTRALHBA: 7HBD: 4#RO5 Violations: ┄HBA (Lipinski): 12HBD (Lipinski): 4#RO5 Violations (Lipinski): 1CX Acidic pKa: 11.93CX Basic pKa: ┄CX LogP: -0.12CX LogD: -0.12Aromatic Rings: 1Heavy Atoms: 35QED Weighted: 0.28Np Likeness Score: -0.82
References 1. Cornish JA, Murray H, Kemp GD, Gani D. (1995) Inhibitors of the adenovirus type 2 proteinase based on substrate-like tetrapeptide nitriles, 5 (1): [10.1016/0960-894X(94)00452-L ]