((S)-1-{(S)-1-[({[(Methoxy-methyl-carbamoyl)-methyl]-carbamoyl}-methyl)-carbamoyl]-ethylcarbamoyl}-3-methyl-butyl)-carbamic acid benzyl ester

ID: ALA327965

PubChem CID: 44332637

Max Phase: Preclinical

Molecular Formula: C23H35N5O7

Molecular Weight: 493.56

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CON(C)C(=O)CNC(=O)CNC(=O)[C@H](C)NC(=O)[C@H](CC(C)C)NC(=O)OCc1ccccc1

Standard InChI:  InChI=1S/C23H35N5O7/c1-15(2)11-18(27-23(33)35-14-17-9-7-6-8-10-17)22(32)26-16(3)21(31)25-12-19(29)24-13-20(30)28(4)34-5/h6-10,15-16,18H,11-14H2,1-5H3,(H,24,29)(H,25,31)(H,26,32)(H,27,33)/t16-,18-/m0/s1

Standard InChI Key:  LNBWAYJIVGUVGI-WMZOPIPTSA-N

Molfile:  

     RDKit          2D

 35 35  0  0  1  0  0  0  0  0999 V2000
    3.9250   -7.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.3625   -7.1042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6417   -7.0917    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.7792   -7.0667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0667   -7.0917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2125   -7.0750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4917   -7.4792    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.7875   -7.5042    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.3542   -7.5042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.2167   -7.5042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.0750   -7.5167    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.6417   -7.5125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.9292   -7.1000    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.9167   -8.3167    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.3625   -6.2792    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.7875   -6.2417    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.0667   -6.2667    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.0667   -7.4792    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.2125   -6.2542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.2125   -8.3292    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.5042   -7.0917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3542   -7.0625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.7292   -7.0167    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3625   -7.4667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9292   -5.8417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.1250   -8.3417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3542   -8.3292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.4917   -7.3292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0750   -7.0500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3625   -8.2917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7250   -5.6292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9292   -5.0167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0750   -8.7000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7875   -7.4542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7958   -8.2875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2 12  1  0
  3  1  1  0
  4  7  1  0
  5  9  1  0
  6  1  1  0
  7  6  1  0
  8  5  1  0
  9  3  1  0
 10 21  1  0
 11  2  1  0
 12 13  1  0
 13 10  1  0
 14  1  2  0
 15  2  2  0
 16  4  2  0
 17  5  2  0
 18  4  1  0
  6 19  1  1
 20 10  2  0
 21  8  1  0
 22 18  1  0
 23 11  1  0
 24 22  1  0
 25 19  1  0
 26 11  1  0
  9 27  1  6
 28 23  1  0
 29 24  2  0
 30 24  1  0
 31 25  1  0
 32 25  1  0
 33 30  2  0
 34 29  1  0
 35 33  1  0
 34 35  2  0
M  END

Associated Targets(non-human)

Human adenovirus 2 (239 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 493.56Molecular Weight (Monoisotopic): 493.2536AlogP: 0.08#Rotatable Bonds: 13
Polar Surface Area: 155.17Molecular Species: NEUTRALHBA: 7HBD: 4
#RO5 Violations: HBA (Lipinski): 12HBD (Lipinski): 4#RO5 Violations (Lipinski): 1
CX Acidic pKa: 11.93CX Basic pKa: CX LogP: -0.12CX LogD: -0.12
Aromatic Rings: 1Heavy Atoms: 35QED Weighted: 0.28Np Likeness Score: -0.82

References

1. Cornish JA, Murray H, Kemp GD, Gani D.  (1995)  Inhibitors of the adenovirus type 2 proteinase based on substrate-like tetrapeptide nitriles,  (1): [10.1016/0960-894X(94)00452-L]

Source