The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
desmethylisaridin C1 ID: ALA3286770
PubChem CID: 86765315
Max Phase: Preclinical
Molecular Formula: C35H53N5O7
Molecular Weight: 655.84
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CC(C)C[C@@H]1NC(=O)[C@H](C(C)C)N(C)C(=O)[C@H](Cc2ccccc2)NC(=O)[C@@H]2CCCN2C(=O)[C@H](CC(C)C)OC(=O)CCNC1=O
Standard InChI: InChI=1S/C35H53N5O7/c1-21(2)18-25-31(42)36-16-15-29(41)47-28(19-22(3)4)35(46)40-17-11-14-27(40)32(43)38-26(20-24-12-9-8-10-13-24)34(45)39(7)30(23(5)6)33(44)37-25/h8-10,12-13,21-23,25-28,30H,11,14-20H2,1-7H3,(H,36,42)(H,37,44)(H,38,43)/t25-,26-,27-,28-,30-/m0/s1
Standard InChI Key: PQDIYZGMQUULNQ-KGEMVMTLSA-N
Molfile:
RDKit 2D
48 50 0 0 0 0 0 0 0 0999 V2000
11.4647 -10.3760 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.1367 -9.9880 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.8086 -10.3760 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.8086 -11.1519 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.4806 -11.5399 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.1367 -11.5399 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.1367 -9.2121 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
12.8086 -8.8241 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.8086 -8.0482 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.4806 -9.2121 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.4806 -7.6603 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.4806 -6.8843 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.1525 -8.0482 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.1367 -6.8843 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.4647 -6.4964 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.8086 -6.4964 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.4647 -5.7205 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.7928 -6.8843 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.1367 -5.3325 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.1367 -4.5566 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.8149 -4.1709 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.8154 -3.3961 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.1426 -3.0069 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.4671 -3.3974 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.4719 -4.1742 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.7928 -5.3325 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.1208 -5.7205 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.4489 -5.3325 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.1208 -6.4964 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.3694 -4.5633 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6082 -4.4008 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2202 -5.0728 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.7392 -5.6502 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.5787 -6.4119 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.1576 -6.9293 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.8434 -6.6519 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.2644 -6.1345 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5291 -6.3746 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9502 -5.8571 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.3686 -7.1321 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6828 -7.4095 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.2617 -7.9269 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1012 -8.6886 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9971 -7.6869 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.6760 -9.2061 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.4154 -8.9660 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.4647 -11.1519 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.9984 -4.7872 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 1
3 4 1 0
4 5 1 0
4 6 1 0
2 7 1 0
7 8 1 0
8 9 1 0
8 10 2 0
9 11 1 1
11 12 1 0
11 13 1 0
14 15 1 0
14 16 1 0
15 17 1 0
15 18 2 0
17 19 1 1
19 20 1 0
20 21 2 0
21 22 1 0
22 23 2 0
23 24 1 0
24 25 2 0
25 20 1 0
17 26 1 0
26 27 1 0
27 28 1 0
27 29 2 0
28 30 1 0
30 31 1 0
31 32 1 0
32 33 1 0
33 28 1 0
33 34 1 0
34 35 2 0
34 36 1 0
36 37 1 1
37 38 1 0
38 39 1 0
38 40 1 0
36 41 1 0
41 42 1 0
42 43 1 0
42 44 2 0
43 45 1 0
45 46 1 0
1 47 2 0
46 1 1 0
9 14 1 0
28 48 1 6
M END Associated Targets(non-human) Molecule Features Natural Product: YesOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 655.84Molecular Weight (Monoisotopic): 655.3945AlogP: 2.20#Rotatable Bonds: 7Polar Surface Area: 154.22Molecular Species: NEUTRALHBA: 7HBD: 3#RO5 Violations: 1HBA (Lipinski): 12HBD (Lipinski): 3#RO5 Violations (Lipinski): 2CX Acidic pKa: 12.07CX Basic pKa: ┄CX LogP: 2.73CX LogD: 2.73Aromatic Rings: 1Heavy Atoms: 47QED Weighted: 0.38Np Likeness Score: 1.30
References 1. Du FY, Zhang P, Li XM, Li CS, Cui CM, Wang BG.. (2014) Cyclohexadepsipeptides of the isaridin class from the marine-derived fungus Beauveria felina EN-135., 77 (5): [PMID:24742254 ] [10.1021/np4011037 ]