2,6-dibromo-4-[2-(dimethylamino)ethyl]phenol

ID: ALA3286793

PubChem CID: 118705731

Max Phase: Preclinical

Molecular Formula: C12H14Br2F3NO3

Molecular Weight: 323.03

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CN(C)CCc1cc(Br)c(O)c(Br)c1.O=C(O)C(F)(F)F

Standard InChI:  InChI=1S/C10H13Br2NO.C2HF3O2/c1-13(2)4-3-7-5-8(11)10(14)9(12)6-7;3-2(4,5)1(6)7/h5-6,14H,3-4H2,1-2H3;(H,6,7)

Standard InChI Key:  LJPPVQQERCRCQP-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 21 20  0  0  0  0  0  0  0  0999 V2000
   16.6341  -20.7664    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.0480  -20.0538    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   15.8091  -20.7648    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   17.0450  -21.4818    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.6309  -22.1953    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   17.8700  -21.4836    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   17.4498  -22.1914    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   14.9651  -18.3040    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.9639  -19.1313    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.6787  -19.5442    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.3951  -19.1308    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.3923  -18.3003    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.6769  -17.8912    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.2505  -17.8917    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0
   17.1052  -17.8851    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0
   15.6745  -17.0662    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   15.6785  -20.3692    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.9640  -20.7815    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.2496  -20.3688    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   13.5351  -20.7811    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.2498  -19.5438    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  1  3  2  0
  1  4  1  0
  4  5  1  0
  4  6  1  0
  4  7  1  0
  8  9  2  0
  9 10  1  0
 10 11  2  0
 11 12  1  0
 12 13  2  0
 13  8  1  0
  8 14  1  0
 12 15  1  0
 13 16  1  0
 10 17  1  0
 17 18  1  0
 18 19  1  0
 19 20  1  0
 19 21  1  0
M  END

Associated Targets(Human)

CCF-STTG1 (114 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 323.03Molecular Weight (Monoisotopic): 320.9364AlogP: 3.02#Rotatable Bonds: 3
Polar Surface Area: 23.47Molecular Species: BASEHBA: 2HBD: 1
#RO5 Violations: HBA (Lipinski): 2HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: 6.86CX Basic pKa: 9.24CX LogP: 2.11CX LogD: 2.04
Aromatic Rings: 1Heavy Atoms: 14QED Weighted: 0.92Np Likeness Score: 0.10

References

1. Tian LW, Feng Y, Shimizu Y, Pfeifer T, Wellington C, Hooper JN, Quinn RJ..  (2014)  Aplysinellamides A-C, bromotyrosine-derived metabolites from an Australian Aplysinella sp. marine sponge.,  77  (5): [PMID:24758268] [10.1021/np500119e]

Source