The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-((cis)-4-(1,5-Dimethyl-1H-pyrazole-3-carboxamido)-cyclohexyl)-5-fluoro-2-(4'-hydroxy-2'-(morpholinomethyl)-biphenyl-3-yloxy)nicotinamide ID: ALA3287739
PubChem CID: 44520546
Max Phase: Preclinical
Molecular Formula: C35H39FN6O5
Molecular Weight: 642.73
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: Cc1cc(C(=O)N[C@H]2CC[C@@H](NC(=O)c3cc(F)cnc3Oc3cccc(-c4ccc(O)cc4CN4CCOCC4)c3)CC2)nn1C
Standard InChI: InChI=1S/C35H39FN6O5/c1-22-16-32(40-41(22)2)34(45)39-27-8-6-26(7-9-27)38-33(44)31-19-25(36)20-37-35(31)47-29-5-3-4-23(18-29)30-11-10-28(43)17-24(30)21-42-12-14-46-15-13-42/h3-5,10-11,16-20,26-27,43H,6-9,12-15,21H2,1-2H3,(H,38,44)(H,39,45)/t26-,27+
Standard InChI Key: HHMPSPSPFJQPAI-MKPDMIMOSA-N
Molfile:
RDKit 2D
47 52 0 0 0 0 0 0 0 0999 V2000
2.3552 -12.0927 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3541 -12.9123 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.0621 -13.3212 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.7718 -12.9118 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7690 -12.0891 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.0603 -11.6839 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.6474 -11.6843 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
4.4801 -13.3193 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.4751 -11.6779 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1844 -12.0838 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.4720 -10.8607 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.4814 -14.1365 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7731 -14.5446 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7740 -15.3611 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4829 -15.7694 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1923 -15.3553 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1879 -14.5402 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.8905 -11.6726 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.6023 -12.0834 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.3064 -11.6757 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.3075 -10.8581 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5984 -10.4500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.8882 -10.8594 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.0152 -10.4495 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.7229 -10.8581 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.3694 -10.3573 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.7229 -11.6753 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.9005 -15.7577 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9033 -16.5760 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.6123 -16.9809 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.3189 -16.5687 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.3121 -15.7473 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.6026 -15.3461 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5962 -14.5289 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.3006 -14.1148 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.0292 -16.9727 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.0080 -14.5185 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.7120 -14.1050 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.7061 -13.2870 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.9902 -12.8842 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.2891 -13.2999 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.1536 -10.5930 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.6140 -9.9167 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.1118 -9.2706 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.3427 -9.5498 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.4308 -9.8910 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3383 -8.4854 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
1 7 1 0
4 8 1 0
5 9 1 0
9 10 1 0
9 11 2 0
8 12 1 0
12 13 2 0
13 14 1 0
14 15 2 0
15 16 1 0
16 17 2 0
17 12 1 0
18 10 1 1
18 19 1 0
18 23 1 0
19 20 1 0
20 21 1 0
21 22 1 0
22 23 1 0
21 24 1 1
24 25 1 0
25 26 1 0
25 27 2 0
28 29 2 0
29 30 1 0
30 31 2 0
31 32 1 0
32 33 2 0
33 28 1 0
16 28 1 0
33 34 1 0
34 35 1 0
31 36 1 0
35 37 1 0
37 38 1 0
38 39 1 0
39 40 1 0
40 41 1 0
41 35 1 0
42 43 1 0
26 42 2 0
43 44 1 0
44 45 2 0
45 26 1 0
43 46 1 0
44 47 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 642.73Molecular Weight (Monoisotopic): 642.2966AlogP: 4.73#Rotatable Bonds: 9Polar Surface Area: 130.84Molecular Species: NEUTRALHBA: 9HBD: 3#RO5 Violations: 1HBA (Lipinski): 11HBD (Lipinski): 3#RO5 Violations (Lipinski): 2CX Acidic pKa: 9.29CX Basic pKa: 6.60CX LogP: 4.13CX LogD: 4.06Aromatic Rings: 4Heavy Atoms: 47QED Weighted: 0.24Np Likeness Score: -1.34
References 1. De Savi C, Cox RJ, Warner DJ, Cook AR, Dickinson MR, McDonough A, Morrill LC, Parker B, Andrews G, Young SS, Gilmour PS, Riley R, Dearman MS.. (2014) Efficacious inhaled PDE4 inhibitors with low emetic potential and long duration of action for the treatment of COPD., 57 (11): [PMID:24785301 ] [10.1021/jm5001216 ]