Methyl(S)-4-((N-benzyl-4-(benzylcarbamoyl)piperidin-4-yl)(4-fluorobenzyl)amino)-3-((tert-butoxycarbonyl)amino-4-oxobutanoate)

ID: ALA3288937

PubChem CID: 90681533

Max Phase: Preclinical

Molecular Formula: C37H45FN4O6

Molecular Weight: 660.79

Molecule Type: Small molecule

Names and Identifiers

Canonical SMILES:  COC(=O)C[C@H](NC(=O)OC(C)(C)C)C(=O)N(Cc1ccc(F)cc1)C1(C(=O)NCc2ccccc2)CCN(Cc2ccccc2)CC1

Standard InChI:  InChI=1S/C37H45FN4O6/c1-36(2,3)48-35(46)40-31(23-32(43)47-4)33(44)42(26-29-15-17-30(38)18-16-29)37(34(45)39-24-27-11-7-5-8-12-27)19-21-41(22-20-37)25-28-13-9-6-10-14-28/h5-18,31H,19-26H2,1-4H3,(H,39,45)(H,40,46)/t31-/m0/s1

Standard InChI Key:  VJVZWYZYRMKOCG-HKBQPEDESA-N

Molfile:  

     RDKit          2D

 48 51  0  0  0  0  0  0  0  0999 V2000
    9.7439   -6.9220    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.7361   -6.5552    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.8072   -7.0914    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.8072   -7.9164    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.3272   -6.3386    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.0260   -7.6973    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.5217   -8.3289    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.0928   -6.6789    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.0928   -5.8539    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.8072   -5.4414    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.3783   -5.4414    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.3783   -4.6164    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.0928   -4.2039    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6638   -4.2039    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3783   -3.7914    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.8784   -8.4527    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.8178  -10.7892    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.6303  -10.9324    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.1606  -10.3004    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.8784   -9.5252    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0660   -9.3819    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5357  -10.0139    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.6909   -9.3819    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.2212  -10.0139    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.9731   -8.6067    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.0337   -9.8707    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.5640  -10.5027    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.2818  -11.2779    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.8121  -11.9099    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.6246  -11.7666    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.9067  -10.9914    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.3764  -10.3594    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2875  -11.4212    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4751  -11.2779    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1929  -10.5027    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3804  -10.3594    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8501  -10.9914    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1323  -11.7666    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9448  -11.9099    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1640   -8.0402    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4495   -8.4527    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7350   -8.0402    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0206   -8.4527    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0206   -9.2777    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7350   -9.6902    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4495   -9.2777    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.6135   -8.4117    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3061   -9.6902    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  1  0
  1  5  2  0
  1  6  1  0
  4  7  2  0
  9 10  2  0
 12 13  1  0
 12 15  1  0
 12 14  1  0
 11 12  1  0
  9 11  1  0
  8  9  1  0
  3  8  1  1
 17 18  1  0
 18 19  1  0
 19 20  1  0
 20 21  1  0
 21 22  1  0
 17 22  1  0
 23 24  1  0
 23 25  2  0
 26 27  1  0
 27 28  1  0
 28 29  2  0
 29 30  1  0
 30 31  2  0
 31 32  1  0
 27 32  2  0
 24 26  1  0
 20 23  1  0
 33 34  1  0
 34 35  1  0
 35 36  2  0
 36 37  1  0
 37 38  2  0
 38 39  1  0
 34 39  2  0
 17 33  1  0
 16 20  1  0
 40 41  1  0
 41 42  1  0
 42 43  2  0
 43 44  1  0
 44 45  2  0
 45 46  1  0
 41 46  2  0
 16 40  1  0
  4 16  1  0
  6 47  1  0
 44 48  1  0
M  END

Alternative Forms

1. Parent:

   

   ALA3288937

   methyl (3S)-4-[[1-benzyl-4-(benzylcarbamoyl)piperidin-4-yl]-[(4-fluorophenyl)methyl]amino]-3-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxobutanoate

Molecule Features

Natural Product: No

Oral: No

Chemical Probe: No

Parenteral: No

Molecule Type: Small molecule

Topical: No

First In Class: No

Black Box: No

Chirality: No

Availability: No

Prodrug: No

Calculated Properties

Molecular Weight: 660.79

Molecular Weight (Monoisotopic): 660.3323

AlogP: 4.96

#Rotatable Bonds: 12

Polar Surface Area: 117.28

Molecular Species: NEUTRAL

HBA: 7

HBD: 2

#RO5 Violations: 1

HBA (Lipinski): 10

HBD (Lipinski): 2

#RO5 Violations (Lipinski): 1

CX Acidic pKa: 13.19

CX Basic pKa: 8.30

CX LogP: 4.52

CX LogD: 3.57

Aromatic Rings: 3

Heavy Atoms: 48

QED Weighted: 0.26

Np Likeness Score: -0.92

References

1. de Castro S, Camarasa MJ, Balzarini J, Velázquez S..  (2014)  Discovery and SAR studies of a novel class of cytotoxic 1,4-disubstituted piperidines via Ugi reaction.,  83  [PMID:24956554] [10.1016/j.ejmech.2014.06.026]

2. de Castro S,Ginex T,Vanderlinden E,Laporte M,Stevaert A,Cumella J,Gago F,Camarasa MJ,Luque FJ,Naesens L,Velazquez S.  (2020)  N-benzyl 4,4-disubstituted piperidines as a potent class of influenza H1N1 virus inhibitors showing a novel mechanism of hemagglutinin fusion peptide interaction.,  194  [PMID:32220685] [10.1016/j.ejmech.2020.112223]

Source

Source(1):

• Scientific Literature