The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Methyl(S)-4-((N-benzyl-4-(benzylcarbamoyl)piperidin-4-yl)(4-fluorobenzyl)amino)-3-((tert-butoxycarbonyl)amino-4-oxobutanoate) ID: ALA3288937
PubChem CID: 90681533
Max Phase: Preclinical
Molecular Formula: C37H45FN4O6
Molecular Weight: 660.79
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COC(=O)C[C@H](NC(=O)OC(C)(C)C)C(=O)N(Cc1ccc(F)cc1)C1(C(=O)NCc2ccccc2)CCN(Cc2ccccc2)CC1
Standard InChI: InChI=1S/C37H45FN4O6/c1-36(2,3)48-35(46)40-31(23-32(43)47-4)33(44)42(26-29-15-17-30(38)18-16-29)37(34(45)39-24-27-11-7-5-8-12-27)19-21-41(22-20-37)25-28-13-9-6-10-14-28/h5-18,31H,19-26H2,1-4H3,(H,39,45)(H,40,46)/t31-/m0/s1
Standard InChI Key: VJVZWYZYRMKOCG-HKBQPEDESA-N
Molfile:
RDKit 2D
48 51 0 0 0 0 0 0 0 0999 V2000
9.7439 -6.9220 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.7361 -6.5552 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8072 -7.0914 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8072 -7.9164 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3272 -6.3386 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.0260 -7.6973 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.5217 -8.3289 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.0928 -6.6789 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.0928 -5.8539 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8072 -5.4414 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.3783 -5.4414 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.3783 -4.6164 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0928 -4.2039 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6638 -4.2039 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.3783 -3.7914 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8784 -8.4527 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.8178 -10.7892 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.6303 -10.9324 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1606 -10.3004 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8784 -9.5252 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0660 -9.3819 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5357 -10.0139 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6909 -9.3819 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2212 -10.0139 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.9731 -8.6067 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.0337 -9.8707 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.5640 -10.5027 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2818 -11.2779 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.8121 -11.9099 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.6246 -11.7666 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.9067 -10.9914 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3764 -10.3594 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2875 -11.4212 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4751 -11.2779 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1929 -10.5027 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3804 -10.3594 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8501 -10.9914 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1323 -11.7666 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9448 -11.9099 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1640 -8.0402 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4495 -8.4527 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7350 -8.0402 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0206 -8.4527 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0206 -9.2777 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7350 -9.6902 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4495 -9.2777 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.6135 -8.4117 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3061 -9.6902 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 1 0
1 5 2 0
1 6 1 0
4 7 2 0
9 10 2 0
12 13 1 0
12 15 1 0
12 14 1 0
11 12 1 0
9 11 1 0
8 9 1 0
3 8 1 1
17 18 1 0
18 19 1 0
19 20 1 0
20 21 1 0
21 22 1 0
17 22 1 0
23 24 1 0
23 25 2 0
26 27 1 0
27 28 1 0
28 29 2 0
29 30 1 0
30 31 2 0
31 32 1 0
27 32 2 0
24 26 1 0
20 23 1 0
33 34 1 0
34 35 1 0
35 36 2 0
36 37 1 0
37 38 2 0
38 39 1 0
34 39 2 0
17 33 1 0
16 20 1 0
40 41 1 0
41 42 1 0
42 43 2 0
43 44 1 0
44 45 2 0
45 46 1 0
41 46 2 0
16 40 1 0
4 16 1 0
6 47 1 0
44 48 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 660.79Molecular Weight (Monoisotopic): 660.3323AlogP: 4.96#Rotatable Bonds: 12Polar Surface Area: 117.28Molecular Species: NEUTRALHBA: 7HBD: 2#RO5 Violations: 1HBA (Lipinski): 10HBD (Lipinski): 2#RO5 Violations (Lipinski): 1CX Acidic pKa: 13.19CX Basic pKa: 8.30CX LogP: 4.52CX LogD: 3.57Aromatic Rings: 3Heavy Atoms: 48QED Weighted: 0.26Np Likeness Score: -0.92
References 1. de Castro S, Camarasa MJ, Balzarini J, Velázquez S.. (2014) Discovery and SAR studies of a novel class of cytotoxic 1,4-disubstituted piperidines via Ugi reaction., 83 [PMID:24956554 ] [10.1016/j.ejmech.2014.06.026 ] 2. de Castro S,Ginex T,Vanderlinden E,Laporte M,Stevaert A,Cumella J,Gago F,Camarasa MJ,Luque FJ,Naesens L,Velazquez S. (2020) N-benzyl 4,4-disubstituted piperidines as a potent class of influenza H1N1 virus inhibitors showing a novel mechanism of hemagglutinin fusion peptide interaction., 194 [PMID:32220685 ] [10.1016/j.ejmech.2020.112223 ]