The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
3-Hydroxy-2-(17'-phenyl-20'-methylenedioxyheptadecanoyl)-cyclohex-2-en-1-one ID: ALA3289511
PubChem CID: 90681783
Max Phase: Preclinical
Molecular Formula: C30H44O5
Molecular Weight: 484.68
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: O=C(CCCCCCCCCCCCCCCCc1ccc2c(c1)OCO2)C1=C(O)CCCC1=O
Standard InChI: InChI=1S/C30H44O5/c31-25(30-26(32)18-15-19-27(30)33)17-14-12-10-8-6-4-2-1-3-5-7-9-11-13-16-24-20-21-28-29(22-24)35-23-34-28/h20-22,32H,1-19,23H2
Standard InChI Key: XNXCGXUXGAPGNC-UHFFFAOYSA-N
Molfile:
RDKit 2D
35 37 0 0 0 0 0 0 0 0999 V2000
31.5826 -6.5509 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.8735 -6.1423 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.8735 -5.3210 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.5826 -4.9124 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.2875 -5.3210 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.2875 -6.1423 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.5826 -7.3681 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
30.1685 -6.5509 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.1685 -7.3681 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.4594 -7.7767 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.7504 -7.3681 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.4594 -6.1423 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
30.1685 -4.9124 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
28.0430 -7.7773 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.3349 -7.3693 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.3342 -6.5521 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.6262 -6.1441 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.9188 -6.5533 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.2108 -6.1453 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.5034 -6.5545 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.7954 -6.1465 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.7947 -5.3293 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.0866 -4.9213 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.0859 -4.1041 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.3779 -3.6961 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.3772 -2.8789 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.6691 -2.4709 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.6724 -1.6514 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.9652 -1.2435 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.9679 -2.8784 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.2601 -2.4742 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.2594 -1.6532 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.4783 -1.4002 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
18.9963 -2.0649 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.4796 -2.7285 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 2 0
3 4 1 0
4 5 1 0
5 6 1 0
1 6 1 0
1 7 2 0
8 9 1 0
9 10 1 0
10 11 1 0
8 12 2 0
2 8 1 0
3 13 1 0
11 14 1 0
14 15 1 0
15 16 1 0
16 17 1 0
17 18 1 0
18 19 1 0
19 20 1 0
20 21 1 0
21 22 1 0
22 23 1 0
23 24 1 0
24 25 1 0
25 26 1 0
26 27 1 0
27 28 2 0
28 29 1 0
29 32 2 0
31 30 2 0
30 27 1 0
31 32 1 0
32 33 1 0
33 34 1 0
34 35 1 0
35 31 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: YesOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 484.68Molecular Weight (Monoisotopic): 484.3189AlogP: 7.94#Rotatable Bonds: 18Polar Surface Area: 72.83Molecular Species: ACIDHBA: 5HBD: 1#RO5 Violations: 1HBA (Lipinski): 5HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: 5.12CX Basic pKa: ┄CX LogP: 8.70CX LogD: 6.44Aromatic Rings: 1Heavy Atoms: 35QED Weighted: 0.17Np Likeness Score: 0.44
References 1. Ferreira EA, Reigada JB, Correia MV, Young MC, Guimarães EF, Franchi GC, Nowill AE, Lago JH, Yamaguchi LF, Kato MJ.. (2014) Antifungal and cytotoxic 2-acylcyclohexane-1,3-diones from Peperomia alata and P. trineura., 77 (6): [PMID:24905499 ] [10.1021/np500130x ]