3-Hydroxy-2-(17'-phenyl-20'-methylenedioxyheptadecanoyl)-cyclohex-2-en-1-one

ID: ALA3289511

PubChem CID: 90681783

Max Phase: Preclinical

Molecular Formula: C30H44O5

Molecular Weight: 484.68

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  O=C(CCCCCCCCCCCCCCCCc1ccc2c(c1)OCO2)C1=C(O)CCCC1=O

Standard InChI:  InChI=1S/C30H44O5/c31-25(30-26(32)18-15-19-27(30)33)17-14-12-10-8-6-4-2-1-3-5-7-9-11-13-16-24-20-21-28-29(22-24)35-23-34-28/h20-22,32H,1-19,23H2

Standard InChI Key:  XNXCGXUXGAPGNC-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 35 37  0  0  0  0  0  0  0  0999 V2000
   31.5826   -6.5509    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.8735   -6.1423    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.8735   -5.3210    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.5826   -4.9124    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.2875   -5.3210    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.2875   -6.1423    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.5826   -7.3681    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   30.1685   -6.5509    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.1685   -7.3681    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.4594   -7.7767    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.7504   -7.3681    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.4594   -6.1423    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   30.1685   -4.9124    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   28.0430   -7.7773    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.3349   -7.3693    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.3342   -6.5521    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.6262   -6.1441    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.9188   -6.5533    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.2108   -6.1453    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.5034   -6.5545    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.7954   -6.1465    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.7947   -5.3293    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.0866   -4.9213    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.0859   -4.1041    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.3779   -3.6961    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.3772   -2.8789    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.6691   -2.4709    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.6724   -1.6514    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.9652   -1.2435    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.9679   -2.8784    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.2601   -2.4742    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.2594   -1.6532    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.4783   -1.4002    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   18.9963   -2.0649    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.4796   -2.7285    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  2  0
  3  4  1  0
  4  5  1  0
  5  6  1  0
  1  6  1  0
  1  7  2  0
  8  9  1  0
  9 10  1  0
 10 11  1  0
  8 12  2  0
  2  8  1  0
  3 13  1  0
 11 14  1  0
 14 15  1  0
 15 16  1  0
 16 17  1  0
 17 18  1  0
 18 19  1  0
 19 20  1  0
 20 21  1  0
 21 22  1  0
 22 23  1  0
 23 24  1  0
 24 25  1  0
 25 26  1  0
 26 27  1  0
 27 28  2  0
 28 29  1  0
 29 32  2  0
 31 30  2  0
 30 27  1  0
 31 32  1  0
 32 33  1  0
 33 34  1  0
 34 35  1  0
 35 31  1  0
M  END

Associated Targets(non-human)

Cladosporium cladosporioides (101 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Cladosporium sphaerospermum (47 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: YesOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 484.68Molecular Weight (Monoisotopic): 484.3189AlogP: 7.94#Rotatable Bonds: 18
Polar Surface Area: 72.83Molecular Species: ACIDHBA: 5HBD: 1
#RO5 Violations: 1HBA (Lipinski): 5HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: 5.12CX Basic pKa: CX LogP: 8.70CX LogD: 6.44
Aromatic Rings: 1Heavy Atoms: 35QED Weighted: 0.17Np Likeness Score: 0.44

References

1. Ferreira EA, Reigada JB, Correia MV, Young MC, Guimarães EF, Franchi GC, Nowill AE, Lago JH, Yamaguchi LF, Kato MJ..  (2014)  Antifungal and cytotoxic 2-acylcyclohexane-1,3-diones from Peperomia alata and P. trineura.,  77  (6): [PMID:24905499] [10.1021/np500130x]

Source