The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
3-methyl-1-(5-(3-(2-(piperidin-1-yl)ethoxy)phenyl)-2-(thiophen-2-yl)thieno[2,3-d]pyrimidin-4-ylamino)-1H-pyrrole-2,5-dione hydrochloride ID: ALA3290631
PubChem CID: 24896719
Max Phase: Preclinical
Molecular Formula: C28H28ClN5O3S2
Molecular Weight: 545.69
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CC1=CC(=O)N(Nc2nc(-c3cccs3)nc3scc(-c4cccc(OCCN5CCCCC5)c4)c23)C1=O.Cl
Standard InChI: InChI=1S/C28H27N5O3S2.ClH/c1-18-15-23(34)33(28(18)35)31-26-24-21(17-38-27(24)30-25(29-26)22-9-6-14-37-22)19-7-5-8-20(16-19)36-13-12-32-10-3-2-4-11-32;/h5-9,14-17H,2-4,10-13H2,1H3,(H,29,30,31);1H
Standard InChI Key: SBXOZKDGWVQQCI-UHFFFAOYSA-N
Molfile:
RDKit 2D
39 43 0 0 0 0 0 0 0 0999 V2000
31.3503 -23.1903 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
27.6503 -24.4454 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
28.3667 -24.0321 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.3639 -23.2017 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
27.6486 -22.7927 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.9357 -24.0326 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.9369 -23.2038 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.1490 -22.9465 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.6607 -23.6163 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.1470 -24.2875 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
27.6468 -21.9678 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
28.3603 -21.5537 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
29.1165 -21.8907 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.6672 -21.2765 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.2531 -20.5629 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.4467 -20.7364 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.8331 -20.1849 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
29.2887 -22.6974 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
30.4877 -21.3609 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.0827 -24.4456 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.1736 -25.2665 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.9823 -25.4384 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.3958 -24.7224 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.8425 -24.1078 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
25.8953 -22.1616 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.4487 -21.5509 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.1955 -20.7666 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.3882 -20.5932 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.8344 -21.2104 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.0905 -21.9923 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.0272 -21.0405 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
23.4764 -21.6546 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.6693 -21.4846 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.1186 -22.0988 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
21.3126 -21.9266 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.7628 -22.5368 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.0154 -23.3224 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.8231 -23.4944 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.3783 -22.8808 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6 2 1 0
2 3 2 0
3 4 1 0
4 5 2 0
5 7 1 0
6 7 2 0
7 8 1 0
8 9 2 0
9 10 1 0
10 6 1 0
5 11 1 0
11 12 1 0
12 13 1 0
13 14 1 0
14 15 2 0
15 16 1 0
16 12 1 0
16 17 2 0
13 18 2 0
14 19 1 0
3 20 1 0
23 24 1 0
21 22 1 0
20 21 2 0
22 23 2 0
24 20 1 0
8 25 1 0
25 26 2 0
26 27 1 0
27 28 2 0
28 29 1 0
29 30 2 0
30 25 1 0
29 31 1 0
31 32 1 0
32 33 1 0
33 34 1 0
34 35 1 0
34 39 1 0
35 36 1 0
36 37 1 0
37 38 1 0
38 39 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 545.69Molecular Weight (Monoisotopic): 545.1555AlogP: 5.59#Rotatable Bonds: 8Polar Surface Area: 87.66Molecular Species: BASEHBA: 9HBD: 1#RO5 Violations: 2HBA (Lipinski): 8HBD (Lipinski): 1#RO5 Violations (Lipinski): 2CX Acidic pKa: 13.94CX Basic pKa: 8.94CX LogP: 5.92CX LogD: 4.38Aromatic Rings: 4Heavy Atoms: 38QED Weighted: 0.29Np Likeness Score: -1.50
References 1. Park CH, Lee C, Yang JS, Joe BY, Chun K, Kim H, Kim HY, Kang JS, Lee JI, Kim MH, Han G.. (2014) Discovery of thienopyrimidine-based FLT3 inhibitors from the structural modification of known IKKβ inhibitors., 24 (12): [PMID:24813730 ] [10.1016/j.bmcl.2014.04.058 ]