The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
6-O-[18F]fluoroethyl-diprenorphine ID: ALA3291211
PubChem CID: 90682588
Max Phase: Preclinical
Molecular Formula: C27H36FNO4
Molecular Weight: 457.59
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CC(C)(O)[C@H]1C[C@@]23CC[C@@]1(OCC[18F])[C@@H]1Oc4c(O)ccc5c4[C@@]12CCN(CC1CC1)[C@@H]3C5
Standard InChI: InChI=1S/C27H36FNO4/c1-24(2,31)19-14-25-7-8-27(19,32-12-10-28)23-26(25)9-11-29(15-16-3-4-16)20(25)13-17-5-6-18(30)22(33-23)21(17)26/h5-6,16,19-20,23,30-31H,3-4,7-15H2,1-2H3/t19-,20-,23-,25-,26+,27+/m1/s1/i28-1
Standard InChI Key: VKHMXTVEQIZBFB-FJTZRJLKSA-N
Molfile:
RDKit 2D
35 41 0 0 0 0 0 0 0 0999 V2000
4.5242 -5.9903 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7051 -5.9903 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9400 -5.2803 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3060 -6.6918 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9274 -6.6918 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0789 -7.1790 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.5032 -4.5704 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3060 -5.2803 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7592 -5.2803 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7051 -4.5704 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5242 -3.7471 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.1041 -5.2762 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1710 -5.9945 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7508 -6.7045 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4827 -6.6918 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1041 -4.2680 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4827 -5.2803 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0668 -5.9903 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0583 -7.4144 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.1583 -7.4227 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.9359 -3.0204 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9232 -7.6118 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
5.2132 -4.1588 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
7.0026 -5.9992 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9359 -6.1121 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7382 -5.8937 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7369 -8.1399 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5141 -2.3034 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5104 -1.4698 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7934 -1.8916 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4144 -6.7219 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4226 -5.2813 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8302 -5.9987 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.1473 -8.8633 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7260 -9.5805 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 1 1 0
4 2 2 0
5 1 1 0
6 5 1 0
7 3 1 0
8 2 1 0
9 3 1 0
10 7 1 0
11 16 1 0
1 12 1 1
13 14 1 0
14 5 1 0
15 4 1 0
16 12 1 0
17 8 2 0
18 17 1 0
19 15 1 0
14 20 1 1
21 11 1 0
5 22 1 1
7 23 1 6
4 6 1 0
7 11 1 0
9 13 1 0
8 10 1 0
18 15 2 0
13 24 1 6
3 25 1 6
25 26 1 0
14 26 1 0
20 27 1 0
21 28 1 0
29 28 1 0
30 29 1 0
28 30 1 0
24 31 1 0
24 32 1 0
24 33 1 0
27 34 1 0
34 35 1 0
M ISO 1 35 18
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 457.59Molecular Weight (Monoisotopic): 457.2628AlogP: 3.73#Rotatable Bonds: 6Polar Surface Area: 62.16Molecular Species: BASEHBA: 5HBD: 2#RO5 Violations: ┄HBA (Lipinski): 5HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: 10.42CX Basic pKa: 9.63CX LogP: 2.49CX LogD: 0.55Aromatic Rings: 1Heavy Atoms: 33QED Weighted: 0.68Np Likeness Score: 1.52
References 1. Schoultz BW, Hjørnevik T, Reed BJ, Marton J, Coello CS, Willoch F, Henriksen G.. (2014) Synthesis and evaluation of three structurally related ¹⁸F-labeled orvinols of different intrinsic activities: 6-O-[¹⁸F]fluoroethyl-diprenorphine ([¹⁸F]FDPN), 6-O-[¹⁸F]fluoroethyl-buprenorphine ([¹⁸F]FBPN), and 6-O-[¹⁸F]fluoroethyl-phenethyl-orvinol ([¹⁸F]FPEO)., 57 (12): [PMID:24933507 ] [10.1021/jm500503k ]