The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
6-O-[18F]-fluoroethyl-phenethyl-orvinol ID: ALA3291213
PubChem CID: 90682590
Max Phase: Preclinical
Molecular Formula: C31H36FNO4
Molecular Weight: 505.63
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CN1CC[C@]23c4c5ccc(O)c4O[C@H]2[C@]2(OCC[18F])C=C[C@@]3(C[C@@H]2[C@@](C)(O)CCc2ccccc2)[C@H]1C5
Standard InChI: InChI=1S/C31H36FNO4/c1-28(35,11-10-20-6-4-3-5-7-20)23-19-29-12-13-31(23,36-17-15-32)27-30(29)14-16-33(2)24(29)18-21-8-9-22(34)26(37-27)25(21)30/h3-9,12-13,23-24,27,34-35H,10-11,14-19H2,1-2H3/t23-,24-,27-,28+,29-,30+,31+/m1/s1/i32-1
Standard InChI Key: ROMGPBJZBHIHQL-YWAACKIKSA-N
Molfile:
RDKit 2D
40 46 0 0 0 0 0 0 0 0999 V2000
20.1053 -5.7910 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.2894 -5.7910 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.5196 -5.0839 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.8919 -6.4898 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.5070 -6.4898 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.6618 -6.9752 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
20.0845 -4.3768 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.8919 -5.0839 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.3355 -5.0839 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.2894 -4.3768 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.1053 -3.5566 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
19.6869 -5.0797 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.7456 -5.7952 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.3272 -6.5023 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.0718 -6.4898 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.6869 -4.0755 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.0718 -5.0839 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.6576 -5.7910 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.6493 -7.2095 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
21.7330 -7.2179 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
20.5154 -2.8327 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.5029 -7.4062 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
20.7916 -3.9667 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
22.5741 -5.8000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.5154 -5.9124 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.3146 -5.6948 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.3134 -7.9321 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.9843 -6.5198 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
22.9924 -5.0848 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.7222 -8.6527 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.3025 -9.3671 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
23.3984 -5.7993 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.8122 -5.0817 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.6407 -5.0812 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.0532 -5.7992 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.8809 -5.7990 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.2955 -5.0808 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.8763 -4.3611 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.0500 -4.3649 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.9590 -4.9918 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 1 1 0
4 2 2 0
5 1 1 0
6 5 1 0
7 3 1 0
8 2 1 0
9 3 1 0
10 7 1 0
11 16 1 0
1 12 1 1
13 14 1 0
14 5 1 0
15 4 1 0
16 12 1 0
17 8 2 0
18 17 1 0
19 15 1 0
14 20 1 1
21 11 1 0
5 22 1 1
7 23 1 6
4 6 1 0
7 11 1 0
9 13 1 0
8 10 1 0
18 15 2 0
13 24 1 0
3 25 1 6
25 26 2 0
14 26 1 0
20 27 1 0
24 28 1 1
24 29 1 0
27 30 1 0
30 31 1 0
24 32 1 0
32 33 1 0
33 34 1 0
34 35 2 0
35 36 1 0
36 37 2 0
37 38 1 0
38 39 2 0
39 34 1 0
13 40 1 1
M ISO 1 31 18
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 505.63Molecular Weight (Monoisotopic): 505.2628AlogP: 4.34#Rotatable Bonds: 7Polar Surface Area: 62.16Molecular Species: BASEHBA: 5HBD: 2#RO5 Violations: 1HBA (Lipinski): 5HBD (Lipinski): 2#RO5 Violations (Lipinski): 1CX Acidic pKa: 10.21CX Basic pKa: 8.99CX LogP: 3.81CX LogD: 2.44Aromatic Rings: 2Heavy Atoms: 37QED Weighted: 0.55Np Likeness Score: 1.38
References 1. Schoultz BW, Hjørnevik T, Reed BJ, Marton J, Coello CS, Willoch F, Henriksen G.. (2014) Synthesis and evaluation of three structurally related ¹⁸F-labeled orvinols of different intrinsic activities: 6-O-[¹⁸F]fluoroethyl-diprenorphine ([¹⁸F]FDPN), 6-O-[¹⁸F]fluoroethyl-buprenorphine ([¹⁸F]FBPN), and 6-O-[¹⁸F]fluoroethyl-phenethyl-orvinol ([¹⁸F]FPEO)., 57 (12): [PMID:24933507 ] [10.1021/jm500503k ]