sodium methyl (benzyloxy)carbonylphosphonate

ID: ALA329654

PubChem CID: 23679405

Max Phase: Preclinical

Molecular Formula: C9H10NaO5P

Molecular Weight: 230.16

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Synonyms: Sodium Methyl (Benzyloxy)Carbonylphosphonate | CHEMBL329654|sodium methyl (benzyloxy)carbonylphosphonate|SCHEMBL10891606|PTLYWFMPCOFHDO-UHFFFAOYSA-M|Sodium methyl benzyloxycarbonylphosphonate

Canonical SMILES:  COP(=O)([O-])C(=O)OCc1ccccc1.[Na+]

Standard InChI:  InChI=1S/C9H11O5P.Na/c1-13-15(11,12)9(10)14-7-8-5-3-2-4-6-8;/h2-6H,7H2,1H3,(H,11,12);/q;+1/p-1

Standard InChI Key:  PTLYWFMPCOFHDO-UHFFFAOYSA-M

Molfile:  

     RDKit          2D

 16 15  0  0  0  0  0  0  0  0999 V2000
    1.8167   -5.1417    0.0000 Na  0  0  0  0  0 15  0  0  0  0  0  0
    1.8917   -3.7000    0.0000 P   0  0  0  0  0  0  0  0  0  0  0  0
    2.4917   -3.7000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8917   -4.3000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.7917   -4.2167    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.8917   -3.1000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.7917   -3.1792    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.2917   -3.7000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.3917   -4.2167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6917   -4.7375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.9917   -3.1792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3875   -5.2542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2875   -4.7292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5875   -5.2500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6875   -5.7750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2875   -5.7750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  3  2  1  0
  4  2  1  0
  5  3  1  0
  6  2  2  0
  7  3  2  0
  8  2  1  0
  9  5  1  0
 10  9  1  0
 11  8  1  0
 12 10  2  0
 13 10  1  0
 14 13  2  0
 15 12  1  0
 16 15  2  0
 14 16  1  0
M  CHG  2   1   1   4  -1
M  END

Associated Targets(non-human)

Human herpesvirus 1 DNA polymerase (160 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Human alphaherpesvirus 1 (11089 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 230.16Molecular Weight (Monoisotopic): 230.0344AlogP: 2.15#Rotatable Bonds: 4
Polar Surface Area: 72.83Molecular Species: ACIDHBA: 4HBD: 1
#RO5 Violations: HBA (Lipinski): 5HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: 0.03CX Basic pKa: CX LogP: 1.53CX LogD: -0.78
Aromatic Rings: 1Heavy Atoms: 15QED Weighted: 0.80Np Likeness Score: -0.08

References

1. Norén JO, Helgstrand E, Johansson NG, Misiorny A, Stening G..  (1983)  Synthesis of esters of phosphonoformic acid and their antiherpes activity.,  26  (2): [PMID:6298425] [10.1021/jm00356a028]

Source