The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-Amino-4-(3-methyl-5-(4-methyl-1H-imidazol-1-yl)-1-phenyl-1H-pyrazol-4-yl)-6-(2-oxo-2H-chromen-3-yl)nicotinonitrile ID: ALA3298188
PubChem CID: 90683014
Max Phase: Preclinical
Molecular Formula: C28H23N7O
Molecular Weight: 473.54
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: Cc1cn(-c2c(-c3cc(/C=C/c4cccc(O)c4)nc(N)c3C#N)c(C)nn2-c2ccccc2)cn1
Standard InChI: InChI=1S/C28H23N7O/c1-18-16-34(17-31-18)28-26(19(2)33-35(28)22-8-4-3-5-9-22)24-14-21(32-27(30)25(24)15-29)12-11-20-7-6-10-23(36)13-20/h3-14,16-17,36H,1-2H3,(H2,30,32)/b12-11+
Standard InChI Key: ZTILZVUHADWMBQ-VAWYXSNFSA-N
Molfile:
RDKit 2D
36 40 0 0 0 0 0 0 0 0999 V2000
21.3690 -29.4056 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.0785 -29.8133 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
22.7842 -29.4027 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.7815 -28.5846 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.0673 -28.1789 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.3646 -28.5918 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.0614 -27.3642 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.7189 -26.8791 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.4608 -26.1037 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
21.6435 -26.1097 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
21.3968 -26.8887 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.4949 -27.1250 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
23.7531 -27.9003 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.5703 -27.8943 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.8171 -27.1152 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
24.1525 -26.6399 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.9371 -25.4419 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.7513 -25.5228 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.2267 -24.8590 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.8889 -24.1169 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.0711 -24.0373 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.5994 -24.7014 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.6215 -27.1470 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.4932 -29.8089 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
23.5954 -28.5811 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.4092 -28.5775 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
20.6628 -29.8169 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.9536 -29.4110 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.2474 -29.8222 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.5422 -29.4130 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.8366 -29.8236 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.8392 -30.6416 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.5534 -31.0474 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.2562 -30.6345 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.0554 -28.5519 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.1275 -29.4173 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
7 8 2 0
8 9 1 0
9 10 1 0
10 11 2 0
11 7 1 0
5 7 1 0
12 13 1 0
13 14 2 0
14 15 1 0
15 16 2 0
16 12 1 0
8 12 1 0
17 18 2 0
18 19 1 0
19 20 2 0
20 21 1 0
21 22 2 0
22 17 1 0
9 17 1 0
11 23 1 0
3 24 1 0
4 25 1 0
25 26 3 0
1 27 1 0
27 28 2 0
28 29 1 0
29 30 2 0
30 31 1 0
31 32 2 0
32 33 1 0
33 34 2 0
34 29 1 0
14 35 1 0
31 36 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 473.54Molecular Weight (Monoisotopic): 473.1964AlogP: 5.07#Rotatable Bonds: 5Polar Surface Area: 118.57Molecular Species: NEUTRALHBA: 8HBD: 2#RO5 Violations: 1HBA (Lipinski): 8HBD (Lipinski): 3#RO5 Violations (Lipinski): 1CX Acidic pKa: 8.75CX Basic pKa: 5.72CX LogP: 4.50CX LogD: 4.47Aromatic Rings: 5Heavy Atoms: 36QED Weighted: 0.37Np Likeness Score: -1.01
References 1. Kalaria PN, Satasia SP, Avalani JR, Raval DK.. (2014) Ultrasound-assisted one-pot four-component synthesis of novel 2-amino-3-cyanopyridine derivatives bearing 5-imidazopyrazole scaffold and their biological broadcast., 83 [PMID:25010936 ] [10.1016/j.ejmech.2014.06.071 ]