The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-Amino-6-(2,2-dimethylbenzo[d][1,3]dioxol-5-yl)-4-(3-methyl-5-(4-methyl-1H-imidazol-1-yl)-1-phenyl-1H-pyrazol-4-yl)nicotinonitrile ID: ALA3298190
PubChem CID: 90683016
Max Phase: Preclinical
Molecular Formula: C29H25N7O2
Molecular Weight: 503.57
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: Cc1cn(-c2c(-c3cc(-c4ccc5c(c4)OC(C)(C)O5)nc(N)c3C#N)c(C)nn2-c2ccccc2)cn1
Standard InChI: InChI=1S/C29H25N7O2/c1-17-15-35(16-32-17)28-26(18(2)34-36(28)20-8-6-5-7-9-20)21-13-23(33-27(31)22(21)14-30)19-10-11-24-25(12-19)38-29(3,4)37-24/h5-13,15-16H,1-4H3,(H2,31,33)
Standard InChI Key: USSDXIRBSDNRQC-UHFFFAOYSA-N
Molfile:
RDKit 2D
38 43 0 0 0 0 0 0 0 0999 V2000
9.5584 -7.7866 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.2681 -7.3772 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.2652 -6.5545 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.9684 -6.1446 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.6779 -6.5522 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
12.3836 -6.1416 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.3809 -5.3236 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.6667 -4.9178 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.9640 -5.3307 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.6608 -4.1032 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.3183 -3.6180 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.0601 -2.8427 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.2429 -2.8486 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.9962 -3.6277 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.0943 -3.8639 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
13.3525 -4.6392 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.1697 -4.6333 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.4165 -3.8542 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
13.7518 -3.3788 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.5364 -2.1808 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.3507 -2.2617 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.8261 -1.5979 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.4883 -0.8558 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.6705 -0.7762 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.1988 -1.4403 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.2209 -3.8859 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.0926 -6.5479 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
13.1947 -5.3200 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.0086 -5.3164 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.5564 -6.1445 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.8478 -7.3749 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.8470 -6.5566 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.0685 -6.3045 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.5882 -6.9670 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.0699 -7.6285 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.6548 -5.2908 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8760 -6.5582 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8760 -7.3712 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31 1 1 0
1 2 2 0
2 3 1 0
3 30 2 0
4 5 2 0
5 6 1 0
6 7 2 0
7 8 1 0
8 9 2 0
9 4 1 0
3 4 1 0
10 11 2 0
11 12 1 0
12 13 1 0
13 14 2 0
14 10 1 0
8 10 1 0
15 16 1 0
16 17 2 0
17 18 1 0
18 19 2 0
19 15 1 0
11 15 1 0
20 21 2 0
21 22 1 0
22 23 2 0
23 24 1 0
24 25 2 0
25 20 1 0
12 20 1 0
14 26 1 0
6 27 1 0
7 28 1 0
28 29 3 0
32 30 1 0
31 32 2 0
32 33 1 0
33 34 1 0
34 35 1 0
35 31 1 0
17 36 1 0
34 37 1 0
34 38 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 503.57Molecular Weight (Monoisotopic): 503.2070AlogP: 5.37#Rotatable Bonds: 4Polar Surface Area: 116.80Molecular Species: NEUTRALHBA: 9HBD: 1#RO5 Violations: 2HBA (Lipinski): 9HBD (Lipinski): 2#RO5 Violations (Lipinski): 2CX Acidic pKa: ┄CX Basic pKa: 5.72CX LogP: 4.36CX LogD: 4.35Aromatic Rings: 5Heavy Atoms: 38QED Weighted: 0.35Np Likeness Score: -1.26
References 1. Kalaria PN, Satasia SP, Avalani JR, Raval DK.. (2014) Ultrasound-assisted one-pot four-component synthesis of novel 2-amino-3-cyanopyridine derivatives bearing 5-imidazopyrazole scaffold and their biological broadcast., 83 [PMID:25010936 ] [10.1016/j.ejmech.2014.06.071 ]