The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
1-(5-Amino-pentyl)-4-benzoyl-3-(1H-indol-3-yl)-1,3,4,5-tetrahydro-benzo[e][1,4]diazepin-2-one ID: ALA330352
PubChem CID: 11754909
Max Phase: Preclinical
Molecular Formula: C30H32N4O2
Molecular Weight: 480.61
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: NCCCCCN1C(=O)C(Cc2c[nH]c3ccccc23)N(C(=O)c2ccccc2)Cc2ccccc21
Standard InChI: InChI=1S/C30H32N4O2/c31-17-9-2-10-18-33-27-16-8-5-13-23(27)21-34(29(35)22-11-3-1-4-12-22)28(30(33)36)19-24-20-32-26-15-7-6-14-25(24)26/h1,3-8,11-16,20,28,32H,2,9-10,17-19,21,31H2
Standard InChI Key: MYNLGMHVEFJZHC-UHFFFAOYSA-N
Molfile:
RDKit 2D
36 40 0 0 0 0 0 0 0 0999 V2000
-3.0333 -1.7375 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.2333 -2.8125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.3500 -2.0875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6750 -3.2542 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-3.0125 -0.9750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.3583 -0.9667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.7333 -2.0625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.4250 -3.2542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7333 -1.6292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8708 -2.7792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.8458 0.1875 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.4375 -0.2417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.1000 -0.8375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.1750 -0.1125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4500 -3.0625 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.3458 -0.6042 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.6625 -0.5750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.3625 -4.0042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1000 -3.0250 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-4.5000 -2.9292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.6083 -3.8750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.5625 -1.1375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.4125 0.3125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.6500 0.1875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.3333 -0.9500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2792 -2.9167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.5375 -4.1250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.2250 -3.5750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0375 -3.4667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.6833 -3.5500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.2375 -4.0250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1500 -0.7125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0750 0.0125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.9833 -0.5500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.3000 0.5833 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.9708 0.2125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 3 1 0
3 1 1 0
4 2 1 0
5 1 1 0
6 9 1 0
7 1 1 0
8 10 2 0
3 9 1 0
10 7 1 0
11 12 1 0
12 6 2 0
13 6 1 0
14 13 2 0
15 2 2 0
16 5 2 0
17 5 1 0
18 4 1 0
19 26 1 0
20 10 1 0
21 8 1 0
22 13 1 0
23 14 1 0
24 17 2 0
25 17 1 0
26 28 1 0
27 18 1 0
28 29 1 0
29 27 1 0
30 20 2 0
31 30 1 0
32 22 2 0
33 32 1 0
34 25 2 0
35 24 1 0
36 34 1 0
8 4 1 0
21 31 2 0
35 36 2 0
14 11 1 0
33 23 2 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 480.61Molecular Weight (Monoisotopic): 480.2525AlogP: 4.90#Rotatable Bonds: 8Polar Surface Area: 82.43Molecular Species: BASEHBA: 3HBD: 2#RO5 Violations: ┄HBA (Lipinski): 6HBD (Lipinski): 3#RO5 Violations (Lipinski): ┄CX Acidic pKa: 13.79CX Basic pKa: 10.21CX LogP: 4.35CX LogD: 1.74Aromatic Rings: 4Heavy Atoms: 36QED Weighted: 0.35Np Likeness Score: -0.36
References 1. Papageorgiou C, Borer X. (1996) A non-peptide ligand for the somatostatin receptor having a benzodiazepinone structure, 6 (3): [10.1016/0960-894X(96)00003-0 ] 2. Papageorgiou C, Borer X. (1996) A non-peptide ligand for the somatostatin receptor having a benzodiazepinone structure, 6 (3): [10.1016/0960-894X(96)00003-0 ] 3. Papageorgiou C, Borer X. (1996) A non-peptide ligand for the somatostatin receptor having a benzodiazepinone structure, 6 (3): [10.1016/0960-894X(96)00003-0 ]