The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(Z)-2-(5-(3,4-Dihydroxybenzylidene)-4-oxo-2-thioxothiazolidin-3-yl)-N-(4-(p-tolyloxy)phenyl)acetamide ID: ALA3309758
PubChem CID: 52940028
Max Phase: Preclinical
Molecular Formula: C25H20N2O5S2
Molecular Weight: 492.58
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: Cc1ccc(Oc2ccc(NC(=O)CN3C(=O)/C(=C/c4ccc(O)c(O)c4)SC3=S)cc2)cc1
Standard InChI: InChI=1S/C25H20N2O5S2/c1-15-2-7-18(8-3-15)32-19-9-5-17(6-10-19)26-23(30)14-27-24(31)22(34-25(27)33)13-16-4-11-20(28)21(29)12-16/h2-13,28-29H,14H2,1H3,(H,26,30)/b22-13-
Standard InChI Key: NDEWWTFWHOMPMV-XKZIYDEJSA-N
Molfile:
RDKit 2D
34 37 0 0 0 0 0 0 0 0999 V2000
1.9508 -1.6550 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.9496 -2.4745 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6577 -2.8835 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3673 -2.4740 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3645 -1.6514 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6559 -1.2461 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2430 -1.2466 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.2416 -2.8826 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.0707 -1.2401 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7799 -1.6460 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8675 -2.4578 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
5.6675 -2.6247 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0735 -1.9154 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.5243 -1.3103 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0027 -3.3700 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
5.6907 -0.5103 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.8858 -1.8269 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.3687 -2.4862 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1811 -2.3976 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.0392 -3.2340 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.6640 -3.0569 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3318 -3.8017 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.8139 -4.4606 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.6272 -4.3724 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.9560 -3.6196 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.4719 -2.9639 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.1110 -5.0310 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.9232 -4.9414 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.4027 -5.6031 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.2142 -5.5139 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.5435 -4.7651 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.0551 -4.1046 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.2453 -4.1971 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.3556 -4.6744 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
1 7 1 0
2 8 1 0
5 9 1 0
9 10 2 0
10 11 1 0
11 12 1 0
12 13 1 0
13 14 1 0
14 10 1 0
12 15 2 0
14 16 2 0
13 17 1 0
17 18 1 0
18 19 1 0
18 20 2 0
19 21 1 0
21 22 2 0
22 23 1 0
23 24 2 0
24 25 1 0
25 26 2 0
26 21 1 0
24 27 1 0
27 28 1 0
28 29 2 0
29 30 1 0
30 31 2 0
31 32 1 0
32 33 2 0
33 28 1 0
31 34 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 492.58Molecular Weight (Monoisotopic): 492.0814AlogP: 5.04#Rotatable Bonds: 6Polar Surface Area: 99.10Molecular Species: NEUTRALHBA: 7HBD: 3#RO5 Violations: 1HBA (Lipinski): 7HBD (Lipinski): 3#RO5 Violations (Lipinski): 1CX Acidic pKa: 9.15CX Basic pKa: ┄CX LogP: 5.28CX LogD: 5.27Aromatic Rings: 3Heavy Atoms: 34QED Weighted: 0.25Np Likeness Score: -1.33
References 1. Zinglé C, Tritsch D, Grosdemange-Billiard C, Rohmer M.. (2014) Catechol-rhodanine derivatives: Specific and promiscuous inhibitors of Escherichia coli deoxyxylulose phosphate reductoisomerase (DXR)., 22 (14): [PMID:24890653 ] [10.1016/j.bmc.2014.05.004 ]