The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
6,7-bis(3-(1H-benzo[d]imidazol-1-yl)-2-hydroxypropoxy)-4-methyl-2H-chromen-2-one ID: ALA3310268
PubChem CID: 118706394
Max Phase: Preclinical
Molecular Formula: C30H28N4O6
Molecular Weight: 540.58
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: Cc1cc(=O)oc2cc(OCC(O)Cn3cnc4ccccc43)c(OCC(O)Cn3cnc4ccccc43)cc12
Standard InChI: InChI=1S/C30H28N4O6/c1-19-10-30(37)40-27-12-29(39-16-21(36)14-34-18-32-24-7-3-5-9-26(24)34)28(11-22(19)27)38-15-20(35)13-33-17-31-23-6-2-4-8-25(23)33/h2-12,17-18,20-21,35-36H,13-16H2,1H3
Standard InChI Key: VYNZRAQVFWVIBY-UHFFFAOYSA-N
Molfile:
RDKit 2D
40 45 0 0 0 0 0 0 0 0999 V2000
10.6737 -12.7019 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.3766 -13.1108 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.0847 -12.7030 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.0856 -11.8858 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.7920 -13.1124 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.5002 -12.7045 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
14.7914 -12.4296 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
14.2438 -13.0361 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.3835 -11.7213 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.5868 -11.8900 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.0444 -11.2850 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.2975 -10.5112 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.0981 -10.3458 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.6370 -10.9521 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.9631 -13.1122 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.9616 -13.9358 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2535 -14.3448 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2553 -12.7074 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.5467 -13.1127 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.5479 -13.9379 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8378 -14.3492 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.1219 -13.9399 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1208 -13.1147 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8354 -12.6988 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4154 -14.3505 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.8354 -11.8817 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.6696 -14.3439 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.3724 -13.9350 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.0806 -14.3428 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.0815 -15.1600 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.7879 -13.9334 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.4960 -14.3412 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
14.7872 -14.6162 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
14.2397 -14.0096 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.3794 -15.3244 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.5827 -15.1558 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.0402 -15.7607 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.2934 -16.5346 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.0940 -16.7000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.6329 -16.0937 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15 1 1 0
1 2 1 0
2 3 1 0
3 4 1 0
3 5 1 0
5 6 1 0
6 10 1 0
9 7 1 0
7 8 2 0
8 6 1 0
9 10 2 0
10 11 1 0
11 12 2 0
12 13 1 0
13 14 2 0
14 9 1 0
15 16 2 0
16 17 1 0
17 20 2 0
19 18 2 0
18 15 1 0
19 20 1 0
19 24 1 0
20 21 1 0
21 22 1 0
22 23 1 0
23 24 2 0
22 25 2 0
24 26 1 0
16 27 1 0
27 28 1 0
28 29 1 0
29 30 1 0
29 31 1 0
31 32 1 0
32 36 1 0
35 33 1 0
33 34 2 0
34 32 1 0
35 36 2 0
36 37 1 0
37 38 2 0
38 39 1 0
39 40 2 0
40 35 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 540.58Molecular Weight (Monoisotopic): 540.2009AlogP: 3.68#Rotatable Bonds: 10Polar Surface Area: 124.77Molecular Species: NEUTRALHBA: 10HBD: 2#RO5 Violations: 1HBA (Lipinski): 10HBD (Lipinski): 2#RO5 Violations (Lipinski): 1CX Acidic pKa: 13.66CX Basic pKa: 5.62CX LogP: 3.13CX LogD: 3.12Aromatic Rings: 6Heavy Atoms: 40QED Weighted: 0.25Np Likeness Score: -0.50
References 1. Damu GL, Cui SF, Peng XM, Wen QM, Cai GX, Zhou CH.. (2014) Synthesis and bioactive evaluation of a novel series of coumarinazoles., 24 (15): [PMID:24930836 ] [10.1016/j.bmcl.2014.05.029 ]