3,5-Dibromo-4-methoxyphenylpyruvic acid

ID: ALA3310983

PubChem CID: 11984438

Max Phase: Preclinical

Molecular Formula: C10H8Br2O4

Molecular Weight: 351.98

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  COc1c(Br)cc(CC(=O)C(=O)O)cc1Br

Standard InChI:  InChI=1S/C10H8Br2O4/c1-16-9-6(11)2-5(3-7(9)12)4-8(13)10(14)15/h2-3H,4H2,1H3,(H,14,15)

Standard InChI Key:  BSZPGRZAJGTIKN-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 16 16  0  0  0  0  0  0  0  0999 V2000
    9.7266   -8.6583    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.0121   -9.0708    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.2976   -8.6583    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.2976   -7.8333    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.0121   -7.4208    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.7266   -7.8333    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.1555   -7.8333    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.1555   -8.6583    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.8700   -9.0708    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.4410   -9.0708    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.4410   -7.4208    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.8700   -7.4208    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.5832   -7.4208    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.8687   -7.8333    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.0121   -6.5958    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0
    7.5832   -9.0708    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  2  0
  3  4  1  0
  4  5  2  0
  5  6  1  0
  1  6  2  0
  7  8  1  0
  8  9  2  0
  8 10  1  0
  7 11  2  0
  7 12  1  0
  1 10  1  0
 13 14  1  0
  4 13  1  0
  5 15  1  0
  3 16  1  0
M  END

Alternative Forms

Associated Targets(Human)

CCF-STTG1 (114 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 351.98Molecular Weight (Monoisotopic): 349.8789AlogP: 2.42#Rotatable Bonds: 4
Polar Surface Area: 63.60Molecular Species: ACIDHBA: 3HBD: 1
#RO5 Violations: HBA (Lipinski): 4HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: 1.54CX Basic pKa: CX LogP: 3.28CX LogD: -0.25
Aromatic Rings: 1Heavy Atoms: 16QED Weighted: 0.85Np Likeness Score: 0.43

References

1. Tian LW, Feng Y, Shimizu Y, Pfeifer TA, Wellington C, Hooper JN, Quinn RJ..  (2014)  ApoE secretion modulating bromotyrosine derivative from the Australian marine sponge Callyspongia sp.,  24  (15): [PMID:24948562] [10.1016/j.bmcl.2014.05.054]

Source