The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
4-[(6-Methoxy-4-methyl-5-(3-(trifluoromethyl)phenoxy)quinolin-8-ylamino)methyl]phenol ID: ALA3311235
PubChem CID: 118707111
Max Phase: Preclinical
Molecular Formula: C25H21F3N2O3
Molecular Weight: 454.45
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: COc1cc(NCc2ccc(O)cc2)c2nccc(C)c2c1Oc1cccc(C(F)(F)F)c1
Standard InChI: InChI=1S/C25H21F3N2O3/c1-15-10-11-29-23-20(30-14-16-6-8-18(31)9-7-16)13-21(32-2)24(22(15)23)33-19-5-3-4-17(12-19)25(26,27)28/h3-13,30-31H,14H2,1-2H3
Standard InChI Key: ZYUGNHPOVKADFZ-UHFFFAOYSA-N
Molfile:
RDKit 2D
33 36 0 0 0 0 0 0 0 0999 V2000
4.1243 -6.5318 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5368 -5.8174 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3618 -5.8174 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7743 -6.5318 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3618 -7.2463 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5368 -7.2463 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2993 -6.5318 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.5993 -6.5318 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0118 -5.8174 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.8368 -4.3884 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.2493 -3.6739 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0743 -3.6739 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.4868 -4.3884 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0743 -5.1029 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.4868 -5.8174 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0743 -6.5318 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2493 -6.5318 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8368 -5.8174 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2493 -5.1029 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3118 -5.8174 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.7243 -6.5318 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.5493 -6.5318 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.9618 -7.2463 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.5493 -7.9608 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.7243 -7.9608 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3118 -7.2463 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.7868 -7.2463 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.6118 -7.2463 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
13.2532 -7.9547 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
13.2532 -6.5379 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
10.3118 -4.3884 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.4868 -7.2463 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.0743 -7.9608 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 2 0
3 4 1 0
4 5 2 0
5 6 1 0
1 6 2 0
1 7 1 0
10 11 2 0
11 12 1 0
12 13 2 0
13 14 1 0
14 15 2 0
15 16 1 0
16 17 2 0
17 18 1 0
18 19 2 0
10 19 1 0
14 19 1 0
21 22 1 0
22 23 2 0
23 24 1 0
24 25 2 0
25 26 1 0
21 26 2 0
20 21 1 0
27 28 1 0
27 29 1 0
27 30 1 0
23 27 1 0
15 20 1 0
13 31 1 0
32 33 1 0
16 32 1 0
9 18 1 0
8 9 1 0
4 8 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 454.45Molecular Weight (Monoisotopic): 454.1504AlogP: 6.68#Rotatable Bonds: 6Polar Surface Area: 63.61Molecular Species: NEUTRALHBA: 5HBD: 2#RO5 Violations: 1HBA (Lipinski): 5HBD (Lipinski): 2#RO5 Violations (Lipinski): 1CX Acidic pKa: 9.49CX Basic pKa: 4.88CX LogP: 5.76CX LogD: 5.75Aromatic Rings: 4Heavy Atoms: 33QED Weighted: 0.34Np Likeness Score: -0.66
References 1. Lu J, Maezawa I, Weerasekara S, Erenler R, Nguyen TD, Nguyen J, Swisher LZ, Li J, Jin LW, Ranjan A, Srivastava SK, Hua DH.. (2014) Syntheses, neural protective activities, and inhibition of glycogen synthase kinase-3β of substituted quinolines., 24 (15): [PMID:24951331 ] [10.1016/j.bmcl.2014.05.085 ]