1-{4-(4-Hydroxyphenyl)butyl}-L-arabino-iminofuranose

ID: ALA3311517

PubChem CID: 118707315

Max Phase: Preclinical

Molecular Formula: C15H23NO4

Molecular Weight: 281.35

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  OC[C@@H]1N[C@@H](CCCCc2ccc(O)cc2)[C@H](O)[C@H]1O

Standard InChI:  InChI=1S/C15H23NO4/c17-9-13-15(20)14(19)12(16-13)4-2-1-3-10-5-7-11(18)8-6-10/h5-8,12-20H,1-4,9H2/t12-,13-,14-,15-/m0/s1

Standard InChI Key:  FSTMLQIUWBDDRD-AJNGGQMLSA-N

Molfile:  

     RDKit          2D

 20 21  0  0  0  0  0  0  0  0999 V2000
    9.3647   -8.5493    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.1392   -8.2887    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.6279   -8.9438    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.1533   -9.6121    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.3752   -9.3654    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.6737   -9.7847    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.3827   -7.5087    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.9599   -9.3869    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2585   -9.8062    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5447   -9.4083    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.6980   -8.0767    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.4451   -8.9342    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.8620   -9.6371    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.8432   -9.8276    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1316   -9.4269    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4306   -9.8454    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4426  -10.6634    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1614  -11.0610    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.8594  -10.6401    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7417  -11.0836    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  1  0
  4  5  1  0
  5  1  1  0
  5  6  1  1
  2  7  1  1
  6  8  1  0
  8  9  1  0
  9 10  1  0
  1 11  1  6
  3 12  1  6
 12 13  1  0
 10 14  1  0
 14 15  2  0
 15 16  1  0
 16 17  2  0
 17 18  1  0
 18 19  2  0
 19 14  1  0
 17 20  1  0
M  END

Alternative Forms

  1. Parent:

    ALA3311517

    ---

Associated Targets(non-human)

Gaa Acidic alpha-glucosidase (551 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Si Sucrase-isomaltase (908 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 281.35Molecular Weight (Monoisotopic): 281.1627AlogP: 0.16#Rotatable Bonds: 6
Polar Surface Area: 92.95Molecular Species: BASEHBA: 5HBD: 5
#RO5 Violations: HBA (Lipinski): 5HBD (Lipinski): 5#RO5 Violations (Lipinski):
CX Acidic pKa: 10.39CX Basic pKa: 9.55CX LogP: 0.52CX LogD: -1.34
Aromatic Rings: 1Heavy Atoms: 20QED Weighted: 0.48Np Likeness Score: 1.63

References

1. Natori Y, Sakuma T, Yoshimura Y, Kinami K, Hirokami Y, Sato K, Adachi I, Kato A, Takahata H..  (2014)  Synthesis and biological evaluation of α-1-C-4'-arylbutyl-L-arabinoiminofuranoses, a new class of α-glucosidase inhibitors.,  24  (15): [PMID:24973028] [10.1016/j.bmcl.2014.06.001]

Source