6-(2-Methoxy-phenylsulfanyl)-5-methyl-7H-pyrrolo[2,3-d]pyrimidine-2,4-diamine

ID: ALA331314

PubChem CID: 5742620

Max Phase: Preclinical

Molecular Formula: C14H15N5OS

Molecular Weight: 301.38

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  COc1ccccc1Sc1[nH]c2nc(N)nc(N)c2c1C

Standard InChI:  InChI=1S/C14H15N5OS/c1-7-10-11(15)17-14(16)19-12(10)18-13(7)21-9-6-4-3-5-8(9)20-2/h3-6H,1-2H3,(H5,15,16,17,18,19)

Standard InChI Key:  WRYKYFPFYKSJNN-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 21 23  0  0  0  0  0  0  0  0999 V2000
    1.8201   -2.1412    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.8201   -2.9662    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1056   -3.3787    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.1056   -1.7287    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5345   -3.3787    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.1056   -0.9037    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.3911   -2.1412    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3911   -2.9662    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3935   -3.2211    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8784   -2.5537    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3935   -1.8863    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6484   -1.1016    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7034   -2.5537    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1159   -1.8392    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7034   -1.1248    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1159   -0.4103    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9409   -0.4103    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.3534   -1.1248    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9409   -1.8392    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.3534   -2.5537    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9409   -3.2682    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  9 10  1  0
 10 11  2  0
 11  7  1  0
  2  5  1  0
 11 12  1  0
  2  3  1  0
 10 13  1  0
  4  6  1  0
 13 14  1  0
  7  8  1  0
 14 15  2  0
  3  8  2  0
 15 16  1  0
  1  2  2  0
 16 17  2  0
  7  4  2  0
 17 18  1  0
  4  1  1  0
 18 19  2  0
 19 14  1  0
  8  9  1  0
 20 21  1  0
 19 20  1  0
M  END

Associated Targets(Human)

DHFR Tclin Dihydrofolate reductase (3072 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Associated Targets(non-human)

Dihydrofolate reductase (1239 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Dihydrofolate reductase (1637 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
folA Dihydrofolate reductase (350 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Dhfr Dihydrofolate reductase (2343 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
DHFR Dihydrofolate reductase (20 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 301.38Molecular Weight (Monoisotopic): 301.0997AlogP: 2.59#Rotatable Bonds: 3
Polar Surface Area: 102.84Molecular Species: NEUTRALHBA: 6HBD: 3
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 5#RO5 Violations (Lipinski):
CX Acidic pKa: 12.29CX Basic pKa: 8.36CX LogP: 2.77CX LogD: 1.79
Aromatic Rings: 3Heavy Atoms: 21QED Weighted: 0.69Np Likeness Score: -0.64

References

1. Gangjee A, Lin X, Queener SF..  (2004)  Design, synthesis, and biological evaluation of 2,4-diamino-5-methyl-6-substituted-pyrrolo[2,3-d]pyrimidines as dihydrofolate reductase inhibitors.,  47  (14): [PMID:15214795] [10.1021/jm0306327]
2. Gangjee A, Lin X, Biondo LR, Queener SF..  (2010)  CoMFA analysis of tgDHFR and rlDHFR based on antifolates with 6-5 fused ring system using the all-orientation search (AOS) routine and a modified cross-validated r(2)-guided region selection (q(2)-GRS) routine and its initial application.,  18  (4): [PMID:20117005] [10.1016/j.bmc.2009.12.066]
3. Shah K, Lin X, Queener SF, Cody V, Pace J, Gangjee A..  (2018)  Targeting species specific amino acid residues: Design, synthesis and biological evaluation of 6-substituted pyrrolo[2,3-d]pyrimidines as dihydrofolate reductase inhibitors and potential anti-opportunistic infection agents.,  26  (9): [PMID:29691153] [10.1016/j.bmc.2018.04.032]

Source