4-(benzylamino)-9,10-dioxo-9,10-dihydroanthracen-1-yl 4-methylbenzenesulfonate

ID: ALA3313950

PubChem CID: 118707340

Max Phase: Preclinical

Molecular Formula: C28H21NO5S

Molecular Weight: 483.55

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  Cc1ccc(S(=O)(=O)Oc2ccc(NCc3ccccc3)c3c2C(=O)c2ccccc2C3=O)cc1

Standard InChI:  InChI=1S/C28H21NO5S/c1-18-11-13-20(14-12-18)35(32,33)34-24-16-15-23(29-17-19-7-3-2-4-8-19)25-26(24)28(31)22-10-6-5-9-21(22)27(25)30/h2-16,29H,17H2,1H3

Standard InChI Key:  MDAPFPOWWAIRNU-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 35 39  0  0  0  0  0  0  0  0999 V2000
    2.5844  -24.3373    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.7604  -24.3373    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    2.1723  -25.0509    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5081  -26.0103    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5070  -26.8367    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7976  -27.2491    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7958  -25.5981    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0788  -26.0066    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0795  -26.8326    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3623  -27.2430    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3733  -25.5931    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3476  -25.9998    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3511  -26.8283    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0695  -27.2378    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7846  -26.8197    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7769  -25.9879    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0581  -25.5823    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3773  -24.7690    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3645  -28.0671    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.0509  -24.7584    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.7537  -23.5161    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4680  -23.1004    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4613  -22.2772    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7435  -21.8706    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0312  -22.2934    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0415  -23.1152    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7352  -21.0526    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0740  -28.0618    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.7898  -28.4698    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7944  -29.2939    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0839  -29.7053    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0880  -30.5285    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8045  -30.9374    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5182  -30.5171    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5105  -29.6952    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  2  0
  4  5  2  0
  5  6  1  0
  6  9  2  0
  8  7  2  0
  7  4  1  0
  8  9  1  0
  9 10  1  0
 10 13  1  0
 12 11  1  0
 11  8  1  0
 12 13  2  0
 13 14  1  0
 14 15  2  0
 15 16  1  0
 16 17  2  0
 17 12  1  0
 11 18  2  0
 10 19  2  0
 17 20  1  0
 20  2  1  0
  2 21  1  0
 21 22  2  0
 22 23  1  0
 23 24  2  0
 24 25  1  0
 25 26  2  0
 26 21  1  0
 24 27  1  0
 14 28  1  0
 28 29  1  0
 29 30  1  0
 30 31  2  0
 31 32  1  0
 32 33  2  0
 33 34  1  0
 34 35  2  0
 35 30  1  0
M  END

Alternative Forms

  1. Parent:

    ALA3313950

    ---

Associated Targets(Human)

Ca-Ski (420 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
SW-620 (52400 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
HepG2 (196354 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 483.55Molecular Weight (Monoisotopic): 483.1140AlogP: 5.15#Rotatable Bonds: 6
Polar Surface Area: 89.54Molecular Species: NEUTRALHBA: 6HBD: 1
#RO5 Violations: 1HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: 1.24CX LogP: 6.50CX LogD: 6.50
Aromatic Rings: 4Heavy Atoms: 35QED Weighted: 0.34Np Likeness Score: -0.50

References

1. Sangthong S, Sangphech N, Palaga T, Ngamrojanavanich N, Puthong S, Vilaivan T, Muangsin N..  (2014)  Anthracene-9, 10-dione derivatives induced apoptosis in human cervical cancer cell line (CaSki) by interfering with HPV E6 expression.,  77  [PMID:24657570] [10.1016/j.ejmech.2014.02.006]

Source