The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
4-(benzylamino)-9,10-dioxo-9,10-dihydroanthracen-1-yl 4-methylbenzenesulfonate ID: ALA3313950
PubChem CID: 118707340
Max Phase: Preclinical
Molecular Formula: C28H21NO5S
Molecular Weight: 483.55
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: Cc1ccc(S(=O)(=O)Oc2ccc(NCc3ccccc3)c3c2C(=O)c2ccccc2C3=O)cc1
Standard InChI: InChI=1S/C28H21NO5S/c1-18-11-13-20(14-12-18)35(32,33)34-24-16-15-23(29-17-19-7-3-2-4-8-19)25-26(24)28(31)22-10-6-5-9-21(22)27(25)30/h2-16,29H,17H2,1H3
Standard InChI Key: MDAPFPOWWAIRNU-UHFFFAOYSA-N
Molfile:
RDKit 2D
35 39 0 0 0 0 0 0 0 0999 V2000
2.5844 -24.3373 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.7604 -24.3373 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
2.1723 -25.0509 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.5081 -26.0103 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5070 -26.8367 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7976 -27.2491 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7958 -25.5981 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0788 -26.0066 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0795 -26.8326 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3623 -27.2430 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3733 -25.5931 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3476 -25.9998 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3511 -26.8283 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0695 -27.2378 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7846 -26.8197 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7769 -25.9879 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0581 -25.5823 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3773 -24.7690 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.3645 -28.0671 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.0509 -24.7584 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.7537 -23.5161 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4680 -23.1004 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4613 -22.2772 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7435 -21.8706 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0312 -22.2934 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0415 -23.1152 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7352 -21.0526 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0740 -28.0618 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.7898 -28.4698 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7944 -29.2939 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0839 -29.7053 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0880 -30.5285 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8045 -30.9374 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5182 -30.5171 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5105 -29.6952 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 2 0
4 5 2 0
5 6 1 0
6 9 2 0
8 7 2 0
7 4 1 0
8 9 1 0
9 10 1 0
10 13 1 0
12 11 1 0
11 8 1 0
12 13 2 0
13 14 1 0
14 15 2 0
15 16 1 0
16 17 2 0
17 12 1 0
11 18 2 0
10 19 2 0
17 20 1 0
20 2 1 0
2 21 1 0
21 22 2 0
22 23 1 0
23 24 2 0
24 25 1 0
25 26 2 0
26 21 1 0
24 27 1 0
14 28 1 0
28 29 1 0
29 30 1 0
30 31 2 0
31 32 1 0
32 33 2 0
33 34 1 0
34 35 2 0
35 30 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 483.55Molecular Weight (Monoisotopic): 483.1140AlogP: 5.15#Rotatable Bonds: 6Polar Surface Area: 89.54Molecular Species: NEUTRALHBA: 6HBD: 1#RO5 Violations: 1HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 1.24CX LogP: 6.50CX LogD: 6.50Aromatic Rings: 4Heavy Atoms: 35QED Weighted: 0.34Np Likeness Score: -0.50
References 1. Sangthong S, Sangphech N, Palaga T, Ngamrojanavanich N, Puthong S, Vilaivan T, Muangsin N.. (2014) Anthracene-9, 10-dione derivatives induced apoptosis in human cervical cancer cell line (CaSki) by interfering with HPV E6 expression., 77 [PMID:24657570 ] [10.1016/j.ejmech.2014.02.006 ]