The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
rac-2-[({2-[4-(3-Carboxy-1-cyclopropyl-6-fluoro-4-oxo-1,4-dihydroquinolin-7-yl)piperazin-1-yl]-2-oxoethyl}carbamoyl)-methyl]-2-hydroxybutanedioic acid ID: ALA3313964
PubChem CID: 118707344
Max Phase: Preclinical
Molecular Formula: C25H27FN4O10
Molecular Weight: 562.51
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: O=C(O)CC(O)(CC(=O)NCC(=O)N1CCN(c2cc3c(cc2F)c(=O)c(C(=O)O)cn3C2CC2)CC1)C(=O)O
Standard InChI: InChI=1S/C25H27FN4O10/c26-16-7-14-17(30(13-1-2-13)12-15(22(14)35)23(36)37)8-18(16)28-3-5-29(6-4-28)20(32)11-27-19(31)9-25(40,24(38)39)10-21(33)34/h7-8,12-13,40H,1-6,9-11H2,(H,27,31)(H,33,34)(H,36,37)(H,38,39)
Standard InChI Key: VYUWJZXPMMZVKJ-UHFFFAOYSA-N
Molfile:
RDKit 2D
40 43 0 0 0 0 0 0 0 0999 V2000
14.3426 -5.1857 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.6406 -6.4317 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
12.9134 -5.1984 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.9232 -6.0276 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.6252 -4.7816 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.3483 -6.0190 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.2073 -6.4445 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.4982 -6.0403 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.6420 -7.2567 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.1877 -4.7944 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.0503 -4.7730 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.4884 -5.2154 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.7905 -6.4612 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
14.0506 -7.9729 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.2338 -7.9742 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.6154 -3.9565 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.3753 -7.3032 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
15.7760 -5.1770 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.7627 -4.8114 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
15.0489 -3.9480 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.8003 -7.2863 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.0731 -6.0573 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.3655 -6.4782 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.0969 -7.7072 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6660 -7.7246 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9464 -7.3210 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6764 -8.5497 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.2370 -7.7426 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.5175 -7.3390 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5071 -6.5139 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.8081 -7.7604 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0885 -7.3569 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3792 -7.7783 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6596 -7.3748 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0781 -6.5319 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7875 -6.1104 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.3586 -6.1284 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.0837 -8.1797 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.6492 -6.5498 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.9502 -7.7962 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2 6 1 0
3 5 1 0
4 2 1 0
5 1 1 0
6 1 2 0
7 4 2 0
8 7 1 0
9 2 1 0
10 3 2 0
11 1 1 0
12 10 1 0
13 8 1 0
14 9 1 0
15 9 1 0
16 5 2 0
17 23 1 0
18 11 2 0
19 12 1 0
20 11 1 0
21 13 1 0
22 13 1 0
23 22 1 0
24 21 1 0
4 3 1 0
15 14 1 0
8 12 2 0
24 17 1 0
17 25 1 0
25 26 1 0
25 27 2 0
26 28 1 0
28 29 1 0
29 30 2 0
29 31 1 0
31 32 1 0
32 33 1 0
33 34 1 0
32 35 1 0
35 36 2 0
35 37 1 0
32 38 1 0
34 39 2 0
34 40 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 562.51Molecular Weight (Monoisotopic): 562.1711AlogP: -0.38#Rotatable Bonds: 10Polar Surface Area: 206.78Molecular Species: ACIDHBA: 9HBD: 5#RO5 Violations: 1HBA (Lipinski): 14HBD (Lipinski): 5#RO5 Violations (Lipinski): 2CX Acidic pKa: 3.13CX Basic pKa: ┄CX LogP: -1.04CX LogD: -8.38Aromatic Rings: 2Heavy Atoms: 40QED Weighted: 0.25Np Likeness Score: -0.61
References 1. Milner SJ, Snelling AM, Kerr KG, Abd-El-Aziz A, Thomas GH, Hubbard RE, Routledge A, Duhme-Klair AK.. (2014) Probing linker design in citric acid-ciprofloxacin conjugates., 22 (16): [PMID:24794750 ] [10.1016/j.bmc.2014.04.009 ]