The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
rac-2-[({5-[4-(3-Carboxy-1-cyclopropyl-6-fluoro-4-oxo-1,4-dihydroquinolin-7-yl)piperazin-1-yl]-5-oxopentyl}carbamoyl)-methyl]-2-hydroxybutanedioic acid ID: ALA3313965
PubChem CID: 118707345
Max Phase: Preclinical
Molecular Formula: C28H33FN4O10
Molecular Weight: 604.59
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: O=C(O)CC(O)(CC(=O)NCCCCC(=O)N1CCN(c2cc3c(cc2F)c(=O)c(C(=O)O)cn3C2CC2)CC1)C(=O)O
Standard InChI: InChI=1S/C28H33FN4O10/c29-19-11-17-20(33(16-4-5-16)15-18(25(17)38)26(39)40)12-21(19)31-7-9-32(10-8-31)23(35)3-1-2-6-30-22(34)13-28(43,27(41)42)14-24(36)37/h11-12,15-16,43H,1-10,13-14H2,(H,30,34)(H,36,37)(H,39,40)(H,41,42)
Standard InChI Key: IZABHASAPWWDJA-UHFFFAOYSA-N
Molfile:
RDKit 2D
43 46 0 0 0 0 0 0 0 0999 V2000
20.7163 -5.2144 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.0144 -6.4603 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
19.2872 -5.2271 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.2971 -6.0563 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.9990 -4.8104 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.7221 -6.0477 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.5811 -6.4731 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.8721 -6.0690 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.0159 -7.2853 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.5615 -4.8232 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.4240 -4.8018 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.8623 -5.2441 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.1646 -6.4899 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
20.4244 -8.0014 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.6076 -8.0027 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.9892 -3.9854 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.7494 -7.3317 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
22.1497 -5.2057 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
17.1367 -4.8402 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
21.4225 -3.9768 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
17.1743 -7.3149 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.4472 -6.0859 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.7397 -6.5068 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.4710 -7.7358 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.0402 -7.7531 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.3206 -7.3496 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.0505 -8.5781 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.6114 -7.7711 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.8918 -7.3676 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.1826 -7.7890 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.4630 -7.3854 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.7538 -7.8068 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.0342 -7.4033 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.7641 -8.6317 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.3250 -7.8247 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6054 -7.4212 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.3207 -6.9958 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.3323 -8.6497 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6214 -9.0685 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.0502 -9.0559 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.8962 -7.8427 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1766 -7.4392 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.9065 -8.6676 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2 6 1 0
3 5 1 0
4 2 1 0
5 1 1 0
6 1 2 0
7 4 2 0
8 7 1 0
9 2 1 0
10 3 2 0
11 1 1 0
12 10 1 0
13 8 1 0
14 9 1 0
15 9 1 0
16 5 2 0
17 23 1 0
18 11 2 0
19 12 1 0
20 11 1 0
21 13 1 0
22 13 1 0
23 22 1 0
24 21 1 0
4 3 1 0
15 14 1 0
8 12 2 0
24 17 1 0
17 25 1 0
25 26 1 0
25 27 2 0
26 28 1 0
28 29 1 0
29 30 1 0
30 31 1 0
31 32 1 0
32 33 1 0
32 34 2 0
33 35 1 0
35 36 1 0
35 37 1 0
35 38 1 0
38 39 2 0
38 40 1 0
36 41 1 0
41 42 1 0
41 43 2 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 604.59Molecular Weight (Monoisotopic): 604.2181AlogP: 0.79#Rotatable Bonds: 13Polar Surface Area: 206.78Molecular Species: ACIDHBA: 9HBD: 5#RO5 Violations: 1HBA (Lipinski): 14HBD (Lipinski): 5#RO5 Violations (Lipinski): 2CX Acidic pKa: 3.43CX Basic pKa: ┄CX LogP: -0.07CX LogD: -6.99Aromatic Rings: 2Heavy Atoms: 43QED Weighted: 0.20Np Likeness Score: -0.50
References 1. Milner SJ, Snelling AM, Kerr KG, Abd-El-Aziz A, Thomas GH, Hubbard RE, Routledge A, Duhme-Klair AK.. (2014) Probing linker design in citric acid-ciprofloxacin conjugates., 22 (16): [PMID:24794750 ] [10.1016/j.bmc.2014.04.009 ]