The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Ethyl 5-(2-(1-methyl-1H-benzo[d]imidazol-2-yl)ethyl)pyrazolo[5,1-f][1,6]naphthyridine-2-carboxylate ID: ALA3317685
PubChem CID: 118708353
Max Phase: Preclinical
Molecular Formula: C23H21N5O2
Molecular Weight: 399.45
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CCOC(=O)c1cc2c3cccnc3cc(CCc3nc4ccccc4n3C)n2n1
Standard InChI: InChI=1S/C23H21N5O2/c1-3-30-23(29)19-14-21-16-7-6-12-24-18(16)13-15(28(21)26-19)10-11-22-25-17-8-4-5-9-20(17)27(22)2/h4-9,12-14H,3,10-11H2,1-2H3
Standard InChI Key: KUGHRAHSLFOUTN-UHFFFAOYSA-N
Molfile:
RDKit 2D
30 34 0 0 0 0 0 0 0 0999 V2000
1.2406 -11.0772 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.5315 -10.6686 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.5315 -9.8514 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2406 -9.4429 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.9456 -9.8514 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6547 -9.4429 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3638 -9.8514 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.3638 -10.6686 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6547 -11.0772 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.9456 -10.6686 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9702 -9.3036 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.6400 -8.5563 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8254 -8.6403 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0486 -7.8472 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6400 -7.1423 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.8658 -7.8472 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.0729 -11.0772 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0729 -11.8944 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7778 -12.3030 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5251 -11.9686 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.0730 -12.5751 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6644 -13.2842 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8660 -13.1134 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.0730 -13.9933 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8902 -13.9933 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.2987 -13.2842 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8902 -12.5751 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6959 -11.1702 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2744 -7.1423 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0915 -7.1423 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 1 0
6 7 1 0
7 8 1 0
8 9 2 0
9 10 1 0
1 10 1 0
5 10 2 0
11 12 2 0
12 13 1 0
6 13 2 0
7 11 1 0
14 15 2 0
14 16 1 0
12 14 1 0
17 18 1 0
19 20 1 0
20 21 1 0
21 22 1 0
22 23 1 0
19 23 2 0
24 25 1 0
25 26 2 0
26 27 1 0
21 27 2 0
22 24 2 0
20 28 1 0
18 19 1 0
8 17 1 0
29 30 1 0
16 29 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 399.45Molecular Weight (Monoisotopic): 399.1695AlogP: 3.73#Rotatable Bonds: 5Polar Surface Area: 74.31Molecular Species: NEUTRALHBA: 7HBD: ┄#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): ┄#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 5.79CX LogP: 3.88CX LogD: 3.87Aromatic Rings: 5Heavy Atoms: 30QED Weighted: 0.42Np Likeness Score: -1.37
References 1. Dore A, Asproni B, Scampuddu A, Pinna GA, Christoffersen CT, Langgård M, Kehler J.. (2014) Synthesis and SAR study of novel tricyclic pyrazoles as potent phosphodiesterase 10A inhibitors., 84 [PMID:25016376 ] [10.1016/j.ejmech.2014.07.020 ]