The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(R)-1-(2,4-dichlorophenyl)-2-(1H-imidazol-1-yl)ethyl 4-[4-(3,4-dichlorophenyl)-piperazin-1-yl]phenylcarbamate ID: ALA3318325
PubChem CID: 76871875
Max Phase: Preclinical
Molecular Formula: C28H25Cl4N5O2
Molecular Weight: 605.35
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: O=C(Nc1ccc(N2CCN(c3ccc(Cl)c(Cl)c3)CC2)cc1)O[C@@H](Cn1ccnc1)c1ccc(Cl)cc1Cl
Standard InChI: InChI=1S/C28H25Cl4N5O2/c29-19-1-7-23(25(31)15-19)27(17-35-10-9-33-18-35)39-28(38)34-20-2-4-21(5-3-20)36-11-13-37(14-12-36)22-6-8-24(30)26(32)16-22/h1-10,15-16,18,27H,11-14,17H2,(H,34,38)/t27-/m0/s1
Standard InChI Key: RKYWJGOKHMLHHS-MHZLTWQESA-N
Molfile:
RDKit 2D
39 43 0 0 0 0 0 0 0 0999 V2000
12.9085 -3.8422 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.6229 -3.4297 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
12.1940 -3.4297 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.9085 -4.6672 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.3374 -3.8422 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.0519 -3.4297 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.7663 -3.8422 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.7663 -4.6672 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.0519 -5.0797 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.3374 -4.6672 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.4808 -5.0797 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
17.1953 -4.6672 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.9097 -5.0797 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.9097 -5.9047 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
17.1953 -6.3172 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.4808 -5.9047 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.6242 -6.3172 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.3388 -5.9047 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.0532 -6.3172 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.0532 -7.1422 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.3388 -7.5548 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.6242 -7.1422 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.7677 -7.5548 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
20.7677 -5.9047 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
12.1940 -5.0797 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.4795 -4.6672 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.6787 -5.9002 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.8718 -6.0717 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.4593 -5.3572 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.0113 -4.7441 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.7651 -5.0797 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
12.1940 -5.9047 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.9085 -6.3172 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.9085 -7.1422 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.1940 -7.5548 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.4795 -7.1422 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.4795 -6.3172 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.1940 -8.3798 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
13.6229 -5.9047 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
1 3 2 0
1 4 1 0
5 6 1 0
6 7 2 0
7 8 1 0
8 9 2 0
9 10 1 0
5 10 2 0
11 12 1 0
12 13 1 0
13 14 1 0
14 15 1 0
15 16 1 0
11 16 1 0
17 18 1 0
18 19 2 0
19 20 1 0
20 21 2 0
21 22 1 0
17 22 2 0
20 23 1 0
19 24 1 0
14 17 1 0
8 11 1 0
2 5 1 0
25 26 1 0
27 28 2 0
28 29 1 0
29 30 2 0
30 31 1 0
27 31 1 0
26 31 1 0
32 33 1 0
33 34 2 0
34 35 1 0
35 36 2 0
36 37 1 0
32 37 2 0
35 38 1 0
33 39 1 0
25 32 1 0
25 4 1 6
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 605.35Molecular Weight (Monoisotopic): 603.0762AlogP: 7.81#Rotatable Bonds: 7Polar Surface Area: 62.63Molecular Species: NEUTRALHBA: 6HBD: 1#RO5 Violations: 2HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski): 2CX Acidic pKa: 13.60CX Basic pKa: 6.77CX LogP: 7.78CX LogD: 7.72Aromatic Rings: 4Heavy Atoms: 39QED Weighted: 0.23Np Likeness Score: -1.32
References 1. Friggeri L, Hargrove TY, Rachakonda G, Williams AD, Wawrzak Z, Di Santo R, De Vita D, Waterman MR, Tortorella S, Villalta F, Lepesheva GI.. (2014) Structural basis for rational design of inhibitors targeting Trypanosoma cruzi sterol 14α-demethylase: two regions of the enzyme molecule potentiate its inhibition., 57 (15): [PMID:25033013 ] [10.1021/jm500739f ]