2-(6-(4-((6-Aminopyridin-3-yl)sulfonyl)piperazin-1-yl)-5-(furan-3-yl)pyridin-3-yl)-1,1,1,3,3,3-hexafluoropropan-2-ol

ID: ALA3319539

PubChem CID: 118709629

Max Phase: Preclinical

Molecular Formula: C21H19F6N5O4S

Molecular Weight: 551.47

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  Nc1ccc(S(=O)(=O)N2CCN(c3ncc(C(O)(C(F)(F)F)C(F)(F)F)cc3-c3ccoc3)CC2)cn1

Standard InChI:  InChI=1S/C21H19F6N5O4S/c22-20(23,24)19(33,21(25,26)27)14-9-16(13-3-8-36-12-13)18(30-10-14)31-4-6-32(7-5-31)37(34,35)15-1-2-17(28)29-11-15/h1-3,8-12,33H,4-7H2,(H2,28,29)

Standard InChI Key:  QGQJZMHESTYQND-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 37 40  0  0  0  0  0  0  0  0999 V2000
    9.2863  -29.0103    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.1035  -29.0144    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    9.6984  -28.3046    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.4045  -30.2443    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.4034  -31.0638    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   10.1114  -31.4728    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.8211  -31.0634    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.8183  -30.2407    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.1096  -29.8354    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.1112  -32.2900    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   10.8137  -28.6075    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   11.5268  -29.0139    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.2312  -28.6067    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.2330  -27.7892    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   11.5242  -27.3805    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.8137  -27.7894    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.9382  -27.3837    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.6459  -27.7945    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.3535  -27.3872    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.3546  -26.5691    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.6422  -26.1601    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.9376  -26.5698    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   15.0620  -26.1601    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.7700  -26.5684    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.0616  -25.3429    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.7660  -25.7457    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   15.7704  -27.3855    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   16.4775  -26.1594    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   16.4718  -26.9756    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   15.7691  -24.9340    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   14.3537  -24.9347    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   15.0561  -24.5240    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   13.6464  -28.6074    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.9916  -29.0858    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.2432  -29.8587    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   14.0562  -29.8583    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.3068  -29.0850    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  2  0
  4  5  2  0
  5  6  1  0
  6  7  2  0
  7  8  1  0
  8  9  2  0
  9  4  1  0
  6 10  1  0
  9  2  1  0
  2 11  1  0
 11 12  1  0
 11 16  1  0
 12 13  1  0
 13 14  1  0
 14 15  1  0
 15 16  1  0
 17 18  2  0
 18 19  1  0
 19 20  2  0
 20 21  1  0
 21 22  2  0
 22 17  1  0
 14 17  1  0
 20 23  1  0
 23 24  1  0
 23 25  1  0
 23 26  1  0
 24 27  1  0
 24 28  1  0
 24 29  1  0
 25 30  1  0
 25 31  1  0
 25 32  1  0
 18 33  1  0
 33 34  2  0
 34 35  1  0
 35 36  1  0
 36 37  2  0
 37 33  1  0
M  END

Alternative Forms

  1. Parent:

    ALA3319539

    ---

Associated Targets(Human)

Liver microsome (8277 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
GCK Tchem Hexokinase type IV (3191 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Associated Targets(non-human)

Gck Glucokinase (92 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Liver microsome (4459 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Biocomponents

Calculated Properties

Molecular Weight: 551.47Molecular Weight (Monoisotopic): 551.1062AlogP: 3.14#Rotatable Bonds: 5
Polar Surface Area: 125.79Molecular Species: NEUTRALHBA: 8HBD: 2
#RO5 Violations: 1HBA (Lipinski): 9HBD (Lipinski): 3#RO5 Violations (Lipinski): 1
CX Acidic pKa: 7.30CX Basic pKa: 5.32CX LogP: 2.50CX LogD: 2.24
Aromatic Rings: 3Heavy Atoms: 37QED Weighted: 0.46Np Likeness Score: -0.88

References

1. Hong FT, Norman MH, Ashton KS, Bartberger MD, Chen J, Chmait S, Cupples R, Fotsch C, Jordan SR, Lloyd DJ, Sivits G, Tadesse S, Hale C, St Jean DJ..  (2014)  Small molecule disruptors of the glucokinase-glucokinase regulatory protein interaction: 4. Exploration of a novel binding pocket.,  57  (14): [PMID:25001129] [10.1021/jm5001979]

Source