The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-(6-(4-((6-Aminopyridin-3-yl)sulfonyl)piperazin-1-yl)-5-(3-fluorophenyl)pyridin-3-yl)-1,1,1,3,3,3-hexafluoropropan-2-ol ID: ALA3319543
PubChem CID: 118709633
Max Phase: Preclinical
Molecular Formula: C23H20F7N5O3S
Molecular Weight: 579.50
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: Nc1ccc(S(=O)(=O)N2CCN(c3ncc(C(O)(C(F)(F)F)C(F)(F)F)cc3-c3cccc(F)c3)CC2)cn1
Standard InChI: InChI=1S/C23H20F7N5O3S/c24-16-3-1-2-14(10-16)18-11-15(21(36,22(25,26)27)23(28,29)30)12-33-20(18)34-6-8-35(9-7-34)39(37,38)17-4-5-19(31)32-13-17/h1-5,10-13,36H,6-9H2,(H2,31,32)
Standard InChI Key: WIKMNRFTFYWDSY-UHFFFAOYSA-N
Molfile:
RDKit 2D
39 42 0 0 0 0 0 0 0 0999 V2000
12.4436 -3.3596 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.2608 -3.3637 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
12.8558 -2.6539 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.5619 -4.5936 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.5607 -5.4131 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
13.2688 -5.8221 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.9784 -5.4126 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.9756 -4.5900 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.2670 -4.1847 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.2686 -6.6393 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
13.9710 -2.9568 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
14.6841 -3.3632 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.3885 -2.9560 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.3903 -2.1384 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
14.6815 -1.7298 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.9710 -2.1387 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.0956 -1.7329 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.8032 -2.1438 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.5108 -1.7364 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.5119 -0.9184 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.7995 -0.5094 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.0949 -0.9191 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
18.2194 -0.5094 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.9273 -0.9176 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.2189 0.3113 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.9233 -0.0949 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
18.9277 -1.7348 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
19.6348 -0.5087 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
19.6291 -1.3248 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
18.9264 0.7195 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
17.5110 0.7203 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
18.2135 1.1267 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
16.8037 -2.9567 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.0981 -3.3594 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.0983 -4.1715 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.8030 -4.5784 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.5091 -4.1672 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.5055 -3.3564 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.2184 -4.5729 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 2 0
4 5 2 0
5 6 1 0
6 7 2 0
7 8 1 0
8 9 2 0
9 4 1 0
6 10 1 0
9 2 1 0
2 11 1 0
11 12 1 0
11 16 1 0
12 13 1 0
13 14 1 0
14 15 1 0
15 16 1 0
17 18 2 0
18 19 1 0
19 20 2 0
20 21 1 0
21 22 2 0
22 17 1 0
14 17 1 0
20 23 1 0
23 24 1 0
23 25 1 0
23 26 1 0
24 27 1 0
24 28 1 0
24 29 1 0
25 30 1 0
25 31 1 0
25 32 1 0
18 33 1 0
33 34 2 0
34 35 1 0
35 36 2 0
36 37 1 0
37 38 2 0
38 33 1 0
37 39 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 579.50Molecular Weight (Monoisotopic): 579.1175AlogP: 3.69#Rotatable Bonds: 5Polar Surface Area: 112.65Molecular Species: NEUTRALHBA: 7HBD: 2#RO5 Violations: 1HBA (Lipinski): 8HBD (Lipinski): 3#RO5 Violations (Lipinski): 1CX Acidic pKa: 7.31CX Basic pKa: 5.42CX LogP: 3.48CX LogD: 3.24Aromatic Rings: 3Heavy Atoms: 39QED Weighted: 0.44Np Likeness Score: -1.17
References 1. Hong FT, Norman MH, Ashton KS, Bartberger MD, Chen J, Chmait S, Cupples R, Fotsch C, Jordan SR, Lloyd DJ, Sivits G, Tadesse S, Hale C, St Jean DJ.. (2014) Small molecule disruptors of the glucokinase-glucokinase regulatory protein interaction: 4. Exploration of a novel binding pocket., 57 (14): [PMID:25001129 ] [10.1021/jm5001979 ]