The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
3-(2-(4-((6-Aminopyridin-3-yl)sulfonyl)piperazin-1-yl)-5-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)pyridin-3-yl)-benzamide ID: ALA3319546
PubChem CID: 118709637
Max Phase: Preclinical
Molecular Formula: C24H22F6N6O4S
Molecular Weight: 604.53
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: NC(=O)c1cccc(-c2cc(C(O)(C(F)(F)F)C(F)(F)F)cnc2N2CCN(S(=O)(=O)c3ccc(N)nc3)CC2)c1
Standard InChI: InChI=1S/C24H22F6N6O4S/c25-23(26,27)22(38,24(28,29)30)16-11-18(14-2-1-3-15(10-14)20(32)37)21(34-12-16)35-6-8-36(9-7-35)41(39,40)17-4-5-19(31)33-13-17/h1-5,10-13,38H,6-9H2,(H2,31,33)(H2,32,37)
Standard InChI Key: TZUUGDAFBFAIPJ-UHFFFAOYSA-N
Molfile:
RDKit 2D
41 44 0 0 0 0 0 0 0 0999 V2000
11.1683 -10.9619 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.9855 -10.9660 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
11.5805 -10.2563 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.2866 -12.1959 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.2854 -13.0155 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.9935 -13.4244 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.7031 -13.0150 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.7003 -12.1923 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.9917 -11.7871 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.9933 -14.2416 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
12.6957 -10.5592 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
13.4088 -10.9656 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.1132 -10.5583 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.1150 -9.7408 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
13.4062 -9.3321 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.6957 -9.7410 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.8203 -9.3353 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.5279 -9.7462 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.2355 -9.3388 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.2366 -8.5207 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.5242 -8.1117 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.8196 -8.5214 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
16.9441 -8.1118 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.6520 -8.5200 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.9436 -7.2946 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.6480 -7.6973 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
17.6524 -9.3372 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
18.3595 -8.1110 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
18.3538 -8.9272 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
17.6511 -6.8856 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
16.2357 -6.8864 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
16.9381 -6.4756 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
15.5284 -10.5590 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.8228 -10.9617 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.8229 -11.7738 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.5277 -12.1807 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.2337 -11.7695 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.2302 -10.9587 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.9431 -12.1752 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.9465 -12.9924 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
17.6491 -11.7637 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 2 0
4 5 2 0
5 6 1 0
6 7 2 0
7 8 1 0
8 9 2 0
9 4 1 0
6 10 1 0
9 2 1 0
2 11 1 0
11 12 1 0
11 16 1 0
12 13 1 0
13 14 1 0
14 15 1 0
15 16 1 0
17 18 2 0
18 19 1 0
19 20 2 0
20 21 1 0
21 22 2 0
22 17 1 0
14 17 1 0
20 23 1 0
23 24 1 0
23 25 1 0
23 26 1 0
24 27 1 0
24 28 1 0
24 29 1 0
25 30 1 0
25 31 1 0
25 32 1 0
18 33 1 0
33 34 2 0
34 35 1 0
35 36 2 0
36 37 1 0
37 38 2 0
38 33 1 0
37 39 1 0
39 40 2 0
39 41 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 604.53Molecular Weight (Monoisotopic): 604.1327AlogP: 2.65#Rotatable Bonds: 6Polar Surface Area: 155.74Molecular Species: NEUTRALHBA: 8HBD: 3#RO5 Violations: 1HBA (Lipinski): 10HBD (Lipinski): 5#RO5 Violations (Lipinski): 1CX Acidic pKa: 7.31CX Basic pKa: 5.43CX LogP: 2.18CX LogD: 1.95Aromatic Rings: 3Heavy Atoms: 41QED Weighted: 0.36Np Likeness Score: -1.10
References 1. Hong FT, Norman MH, Ashton KS, Bartberger MD, Chen J, Chmait S, Cupples R, Fotsch C, Jordan SR, Lloyd DJ, Sivits G, Tadesse S, Hale C, St Jean DJ.. (2014) Small molecule disruptors of the glucokinase-glucokinase regulatory protein interaction: 4. Exploration of a novel binding pocket., 57 (14): [PMID:25001129 ] [10.1021/jm5001979 ]