The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-amino-1-(2-fluoro-5-(3-(trifluoromethyl)benzamido)phenyl)-1H-pyrrolo[2,3-b]quinoxaline-3-carboxamide ID: ALA3321813
PubChem CID: 118386996
Max Phase: Preclinical
Molecular Formula: C25H16F4N6O2
Molecular Weight: 508.44
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: NC(=O)c1c(N)n(-c2cc(NC(=O)c3cccc(C(F)(F)F)c3)ccc2F)c2nc3ccccc3nc12
Standard InChI: InChI=1S/C25H16F4N6O2/c26-15-9-8-14(32-24(37)12-4-3-5-13(10-12)25(27,28)29)11-18(15)35-21(30)19(22(31)36)20-23(35)34-17-7-2-1-6-16(17)33-20/h1-11H,30H2,(H2,31,36)(H,32,37)
Standard InChI Key: HTDKSCVGBSIHQY-UHFFFAOYSA-N
Molfile:
RDKit 2D
37 41 0 0 0 0 0 0 0 0999 V2000
10.6824 -22.3279 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.3968 -21.9154 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.3968 -21.0904 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.6824 -20.6779 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.9679 -21.0904 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2534 -20.6779 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.5390 -21.0904 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.5390 -21.9154 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2534 -22.3279 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.9679 -21.9154 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.1814 -22.1704 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
12.1814 -20.8355 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.6663 -21.5029 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.4364 -20.0509 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.8843 -19.4378 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.2333 -19.8373 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
12.4364 -22.9551 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.8843 -23.5681 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.1392 -24.3527 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.9463 -24.5242 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.4983 -23.9112 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.2434 -23.1266 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.4914 -21.5029 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
14.3053 -24.0827 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
14.5602 -24.8674 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.3672 -25.0389 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.0081 -25.4804 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.6190 -25.8243 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.4251 -25.9961 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.9781 -25.3826 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.7193 -24.5947 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.9138 -24.4267 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.6797 -26.7808 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.1274 -27.3936 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
17.4866 -26.9527 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
17.0876 -27.4918 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
11.0774 -23.3965 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 7 1 0
7 8 2 0
8 9 1 0
9 10 2 0
1 10 1 0
5 10 1 0
12 13 2 0
11 13 1 0
2 11 1 0
3 12 1 0
14 15 2 0
14 16 1 0
12 14 1 0
17 18 1 0
18 19 2 0
19 20 1 0
20 21 2 0
21 22 1 0
17 22 2 0
11 17 1 0
13 23 1 0
21 24 1 0
24 25 1 0
25 26 1 0
25 27 2 0
26 28 2 0
28 29 1 0
29 30 2 0
30 31 1 0
31 32 2 0
32 26 1 0
29 33 1 0
33 34 1 0
33 35 1 0
33 36 1 0
18 37 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 508.44Molecular Weight (Monoisotopic): 508.1271AlogP: 4.67#Rotatable Bonds: 4Polar Surface Area: 128.92Molecular Species: NEUTRALHBA: 6HBD: 3#RO5 Violations: 1HBA (Lipinski): 8HBD (Lipinski): 5#RO5 Violations (Lipinski): 1CX Acidic pKa: 13.89CX Basic pKa: 0.78CX LogP: 4.91CX LogD: 4.91Aromatic Rings: 5Heavy Atoms: 37QED Weighted: 0.30Np Likeness Score: -1.76
References 1. Unzue A, Dong J, Lafleur K, Zhao H, Frugier E, Caflisch A, Nevado C.. (2014) Pyrrolo[3,2-b]quinoxaline derivatives as types I1/2 and II Eph tyrosine kinase inhibitors: structure-based design, synthesis, and in vivo validation., 57 (15): [PMID:25076195 ] [10.1021/jm5009242 ]