The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
5-Chloro-2-(N-(4-(1,3-dioxo-1H-benzo[de]isoquinolin-2(3H)-yl)butyl)sulfamoyl)benzoicacid ID: ALA3322514
Cas Number: 1622006-09-0
PubChem CID: 77461257
Product Number: R613086, Order Now?
Max Phase: Preclinical
Molecular Formula: C23H19ClN2O6S
Molecular Weight: 486.93
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: O=C(O)c1cc(Cl)ccc1S(=O)(=O)NCCCCN1C(=O)c2cccc3cccc(c23)C1=O
Standard InChI: InChI=1S/C23H19ClN2O6S/c24-15-9-10-19(18(13-15)23(29)30)33(31,32)25-11-1-2-12-26-21(27)16-7-3-5-14-6-4-8-17(20(14)16)22(26)28/h3-10,13,25H,1-2,11-12H2,(H,29,30)
Standard InChI Key: OVJUYQCJIFWMBI-UHFFFAOYSA-N
Molfile:
RDKit 2D
33 36 0 0 0 0 0 0 0 0999 V2000
7.9059 -8.2980 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.3278 -7.5982 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
7.5108 -7.5827 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.0327 -8.0157 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.3414 -6.7806 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0555 -6.3857 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0667 -5.5693 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3640 -5.1510 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6485 -5.5540 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6408 -6.3691 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0236 -8.8328 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2307 -12.9223 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2296 -13.7419 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9376 -14.1508 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6452 -13.7377 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3537 -14.1448 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0620 -13.7340 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0573 -12.9118 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6444 -12.9187 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3482 -12.5100 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3452 -11.6979 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6390 -11.2937 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.9345 -11.7074 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9411 -12.5181 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0513 -11.2867 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.2237 -11.3043 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.6345 -10.4765 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3399 -10.0640 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3354 -9.2468 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9272 -6.7742 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2230 -6.3596 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.9203 -7.5913 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.3738 -4.3339 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 2 0
4 2 1 0
2 5 1 0
5 6 2 0
6 7 1 0
7 8 2 0
8 9 1 0
9 10 2 0
10 5 1 0
4 11 1 0
12 13 1 0
13 14 2 0
14 15 1 0
24 12 2 0
19 15 1 0
15 16 2 0
16 17 1 0
17 18 2 0
18 20 1 0
19 20 2 0
20 21 1 0
21 22 1 0
22 23 1 0
23 24 1 0
24 19 1 0
21 25 2 0
23 26 2 0
22 27 1 0
27 28 1 0
28 29 1 0
29 11 1 0
30 31 1 0
30 32 2 0
10 30 1 0
8 33 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 486.93Molecular Weight (Monoisotopic): 486.0652AlogP: 3.55#Rotatable Bonds: 8Polar Surface Area: 120.85Molecular Species: ACIDHBA: 5HBD: 2#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: 1.96CX Basic pKa: ┄CX LogP: 3.38CX LogD: -0.15Aromatic Rings: 3Heavy Atoms: 33QED Weighted: 0.37Np Likeness Score: -1.19
References 1. Patil R, Fells JI, Szabó E, Lim KG, Norman DD, Balogh A, Patil S, Strobos J, Miller DD, Tigyi GJ.. (2014) Design and synthesis of sulfamoyl benzoic acid analogues with subnanomolar agonist activity specific to the LPA2 receptor., 57 (16): [PMID:25100502 ] [10.1021/jm5007116 ]