{7-Chloro-4-oxo-2-piperidin-1-ylmethyl-6-[(prop-2-ynyl-{4-[(pyridin-3-ylmethyl)-carbamoyl]-phenyl}-amino)-methyl]-4H-quinazolin-3-yl}-acetic acid methyl ester

ID: ALA332517

PubChem CID: 10919234

Max Phase: Preclinical

Molecular Formula: C34H35ClN6O4

Molecular Weight: 627.14

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  C#CCN(Cc1cc2c(=O)n(CC(=O)OC)c(CN3CCCCC3)nc2cc1Cl)c1ccc(C(=O)NCc2cccnc2)cc1

Standard InChI:  InChI=1S/C34H35ClN6O4/c1-3-14-40(27-11-9-25(10-12-27)33(43)37-20-24-8-7-13-36-19-24)21-26-17-28-30(18-29(26)35)38-31(22-39-15-5-4-6-16-39)41(34(28)44)23-32(42)45-2/h1,7-13,17-19H,4-6,14-16,20-23H2,2H3,(H,37,43)

Standard InChI Key:  LQJDQDFHDDQEBR-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 45 49  0  0  0  0  0  0  0  0999 V2000
    0.6667   -2.5875    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.3750   -2.1667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.6667   -3.4125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0875   -2.5875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3750   -3.8167    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.0875   -3.4125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5042   -2.5792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7917   -2.1750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8000   -3.8167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.2292   -2.5750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5125   -3.4042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0500   -2.1750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2167   -2.1667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0500   -3.8250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9375   -2.5792    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0500   -4.6500    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.6417   -1.3292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3500   -0.9167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.9417   -2.1542    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7625   -2.5917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3750   -1.3417    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.4042   -2.5792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7625   -2.5792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4417   -3.3667    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.0667   -0.9000    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7625   -3.4167    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.9917   -3.2917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9875   -1.8625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1667   -3.2917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1667   -1.8667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.3667   -2.1417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.6542   -2.5625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2250   -3.8167    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
    4.9292   -1.7542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4833   -2.1792    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.3542   -1.3167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.6667   -5.0542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7583   -5.0625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.7875   -1.3000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.0792   -2.5417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2000   -1.7667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.7917   -2.1250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.6667   -5.8792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7625   -5.8792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0458   -6.2917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  1  1  0
  4  2  1  0
  5  3  2  0
  6  5  1  0
  7  8  2  0
  8  4  1  0
  9  6  1  0
 10 22  1  0
 11  9  2  0
 12  1  1  0
 13  7  1  0
 14  3  1  0
 15 13  1  0
 16 14  1  0
 17 34  1  0
 18 17  3  0
 19 10  1  0
 20 12  1  0
 21  2  2  0
 22 28  1  0
 23 15  1  0
 24 10  2  0
 25 36  1  0
 26 20  2  0
 27 29  1  0
 28 30  2  0
 29 23  2  0
 30 23  1  0
 31 32  1  0
 32 19  1  0
 33 11  1  0
 34 15  1  0
 35 20  1  0
 36 31  2  0
 37 16  1  0
 38 16  1  0
 39 42  1  0
 40 31  1  0
 41 35  1  0
 42 40  2  0
 43 37  1  0
 44 38  1  0
 45 44  1  0
  6  4  2  0
 11  7  1  0
 43 45  1  0
 22 27  2  0
 39 25  2  0
M  END

Associated Targets(Human)

WIL2 (182 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 627.14Molecular Weight (Monoisotopic): 626.2408AlogP: 4.17#Rotatable Bonds: 11
Polar Surface Area: 109.66Molecular Species: NEUTRALHBA: 9HBD: 1
#RO5 Violations: 1HBA (Lipinski): 10HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: 6.44CX LogP: 3.61CX LogD: 3.56
Aromatic Rings: 4Heavy Atoms: 45QED Weighted: 0.20Np Likeness Score: -1.80

References

1. Bavetsias V, Skelton LA, Yafai F, Mitchell F, Wilson SC, Allan B, Jackman AL..  (2002)  The design and synthesis of water-soluble analogues of CB30865, a quinazolin-4-one-based antitumor agent.,  45  (17): [PMID:12166942] [10.1021/jm011081s]

Source