N'-(4-hydroxy-3-nitrobenzoyl)-3-(4-propylphenyl)furan-2-carbohydrazide

ID: ALA3325456

PubChem CID: 11640146

Max Phase: Preclinical

Molecular Formula: C21H19N3O6

Molecular Weight: 409.40

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CCCc1ccc(-c2ccoc2C(=O)NNC(=O)c2ccc(O)c([N+](=O)[O-])c2)cc1

Standard InChI:  InChI=1S/C21H19N3O6/c1-2-3-13-4-6-14(7-5-13)16-10-11-30-19(16)21(27)23-22-20(26)15-8-9-18(25)17(12-15)24(28)29/h4-12,25H,2-3H2,1H3,(H,22,26)(H,23,27)

Standard InChI Key:  HIIHXFJANMZVSX-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 30 32  0  0  0  0  0  0  0  0999 V2000
   16.2032    0.3086    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.4569    0.6360    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.9096    0.0294    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   15.3177   -0.6797    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.1171   -0.5103    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.7224   -1.0562    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.5503   -1.8562    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.1564   -2.4032    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.9348   -2.1514    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.1036   -1.3475    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.4962   -0.8040    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.9848   -1.4260    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.1720   -1.5109    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   15.4646   -2.0875    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   13.8391   -2.2572    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   13.0263   -2.3420    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.6934   -3.0883    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.5464   -1.6806    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.8802   -3.1683    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.5473   -3.9137    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.0273   -4.5762    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.8440   -4.4883    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.1732   -3.7426    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.6954   -5.3229    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.7371   -4.0001    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   10.4050   -4.7468    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.2554   -3.3434    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   18.5424   -2.6978    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.3730   -3.4973    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.5959   -3.7502    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  1  0
  4  5  2  0
  5  1  1  0
  6  7  2  0
  7  8  1  0
  8  9  2  0
  9 10  1  0
 10 11  2  0
 11  6  1  0
  5  6  1  0
  4 12  1  0
 12 13  1  0
 12 14  2  0
 13 15  1  0
 15 16  1  0
 16 17  1  0
 16 18  2  0
 17 19  2  0
 19 20  1  0
 20 21  2  0
 21 22  1  0
 22 23  2  0
 23 17  1  0
 21 24  1  0
 20 25  1  0
 25 26  2  0
 25 27  1  0
  9 28  1  0
 28 29  1  0
 29 30  1  0
M  CHG  2  25   1  27  -1
M  END

Associated Targets(non-human)

Gcgr Glucagon receptor (262 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 409.40Molecular Weight (Monoisotopic): 409.1274AlogP: 3.59#Rotatable Bonds: 6
Polar Surface Area: 134.71Molecular Species: ACIDHBA: 6HBD: 3
#RO5 Violations: HBA (Lipinski): 9HBD (Lipinski): 3#RO5 Violations (Lipinski):
CX Acidic pKa: 5.75CX Basic pKa: CX LogP: 3.84CX LogD: 2.02
Aromatic Rings: 3Heavy Atoms: 30QED Weighted: 0.42Np Likeness Score: -1.00

References

1. Hasegawa F, Niidome K, Migihashi C, Murata M, Negoro T, Matsumoto T, Kato K, Fujii A..  (2014)  Discovery of furan-2-carbohydrazides as orally active glucagon receptor antagonists.,  24  (17): [PMID:25127101] [10.1016/j.bmcl.2014.07.025]

Source