The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
MRT 12113 ID: ALA3325855
PubChem CID: 24762179
Max Phase: Preclinical
Molecular Formula: C30H24O13
Molecular Weight: 592.51
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: Oc1ccc(C2Oc3c(c(O)cc4c3C3c5c(O)cc(O)c(O)c5OC(c5ccc(O)c(O)c5)(O4)C3O)CC2O)cc1O
Standard InChI: InChI=1S/C30H24O13/c31-13-3-1-10(5-16(13)34)26-20(38)7-12-15(33)9-21-23(27(12)41-26)24-22-18(36)8-19(37)25(39)28(22)43-30(42-21,29(24)40)11-2-4-14(32)17(35)6-11/h1-6,8-9,20,24,26,29,31-40H,7H2
Standard InChI Key: IUPQNGNZYZDZOI-UHFFFAOYSA-N
Molfile:
RDKit 2D
43 49 0 0 0 0 0 0 0 0999 V2000
3.7461 -2.6620 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7450 -3.4816 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4530 -3.8905 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4512 -2.2532 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1598 -2.6584 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1632 -3.4836 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.8756 -3.8910 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5892 -3.4778 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5858 -2.6526 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.8688 -2.2406 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.8796 -4.7048 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.8826 -6.3386 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5915 -5.9237 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5861 -5.1087 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1732 -5.9312 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1712 -5.1114 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4642 -4.7055 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.7547 -5.1148 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7567 -5.9346 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4682 -6.3450 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.0486 -4.7089 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.0491 -3.8906 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3418 -3.4828 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.6336 -3.8922 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.6371 -4.7136 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3449 -5.1177 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.2912 -2.2421 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.0004 -2.6502 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.7064 -2.2401 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.7043 -1.4221 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9904 -1.0159 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.2873 -1.4283 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4488 -1.4360 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.0383 -2.2536 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.9249 -3.4853 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.9312 -5.1254 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.4152 -2.6469 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.4102 -1.0104 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.8859 -7.1558 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.0495 -6.3442 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.2980 -3.8844 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.7393 -4.2923 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.4443 -3.9869 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 6 2 0
5 4 2 0
4 1 1 0
5 6 1 0
5 10 1 0
6 7 1 0
7 8 1 0
8 9 1 0
9 10 1 0
11 16 2 0
15 12 2 0
12 13 1 0
13 14 2 0
14 11 1 0
7 11 1 0
15 16 1 0
15 20 1 0
16 17 1 0
17 18 1 0
18 19 1 0
19 20 1 0
21 22 2 0
22 23 1 0
23 24 2 0
24 25 1 0
25 26 2 0
26 21 1 0
18 21 1 0
27 28 2 0
28 29 1 0
29 30 2 0
30 31 1 0
31 32 2 0
32 27 1 0
9 27 1 0
4 33 1 0
1 34 1 0
24 35 1 0
25 36 1 0
29 37 1 0
30 38 1 0
12 39 1 0
19 40 1 0
8 41 1 0
3 42 1 0
14 43 1 0
9 43 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 592.51Molecular Weight (Monoisotopic): 592.1217AlogP: 2.50#Rotatable Bonds: 2Polar Surface Area: 229.99Molecular Species: NEUTRALHBA: 13HBD: 10#RO5 Violations: 3HBA (Lipinski): 13HBD (Lipinski): 10#RO5 Violations (Lipinski): 3CX Acidic pKa: 8.71CX Basic pKa: ┄CX LogP: 3.29CX LogD: 3.27Aromatic Rings: 4Heavy Atoms: 43QED Weighted: 0.12Np Likeness Score: 2.19
References 1. Kher SS, Penzo M, Fulle S, Finn PW, Blackman MJ, Jirgensons A.. (2014) Substrate derived peptidic α-ketoamides as inhibitors of the malarial protease PfSUB1., 24 (18): [PMID:25129616 ] [10.1016/j.bmcl.2014.07.086 ] 2. Lidumniece E, Withers-Martinez C, Hackett F, Blackman MJ, Jirgensons A.. (2022) Subtilisin-like Serine Protease 1 (SUB1) as an Emerging Antimalarial Drug Target: Current Achievements in Inhibitor Discovery., 65 (19.0): [PMID:36137276 ] [10.1021/acs.jmedchem.2c01093 ]